Difference between revisions of "CPD-13518"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13518 CPD-13518] == * smiles: ** C(NC(NO)=[N+])CCC([N+])C([O-])=O * common name: ** N&omega...") |
|||
Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C(NC(NO)=[N+])CCC([N+])C([O-])=O | ** C(NC(NO)=[N+])CCC([N+])C([O-])=O | ||
− | |||
− | |||
− | |||
− | |||
* molecular weight: | * molecular weight: | ||
** 191.209 | ** 191.209 | ||
+ | * inchi key: | ||
+ | ** InChIKey=FQWRAVYMZULPNK-BYPYZUCNSA-O | ||
+ | * common name: | ||
+ | ** Nω-hydroxy-L-arginine | ||
* Synonym(s): | * Synonym(s): | ||
** L-hydroxyarginine | ** L-hydroxyarginine | ||
Line 18: | Line 18: | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | |||
− | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=60107 60107] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=60107 60107] | ||
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=36688091 36688091] | ||
{{#set: smiles=C(NC(NO)=[N+])CCC([N+])C([O-])=O}} | {{#set: smiles=C(NC(NO)=[N+])CCC([N+])C([O-])=O}} | ||
− | |||
− | |||
{{#set: molecular weight=191.209 }} | {{#set: molecular weight=191.209 }} | ||
+ | {{#set: inchi key=InChIKey=FQWRAVYMZULPNK-BYPYZUCNSA-O}} | ||
+ | {{#set: common name=Nω-hydroxy-L-arginine}} | ||
{{#set: common name=L-hydroxyarginine}} | {{#set: common name=L-hydroxyarginine}} | ||
{{#set: consumed by=RXN-13565}} | {{#set: consumed by=RXN-13565}} | ||
{{#set: produced by=RXN-13564}} | {{#set: produced by=RXN-13564}} |
Latest revision as of 13:35, 10 January 2019
Contents
Metabolite CPD-13518
- smiles:
- C(NC(NO)=[N+])CCC([N+])C([O-])=O
- molecular weight:
- 191.209
- inchi key:
- InChIKey=FQWRAVYMZULPNK-BYPYZUCNSA-O
- common name:
- Nω-hydroxy-L-arginine
- Synonym(s):
- L-hydroxyarginine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(NC(NO)=[N+])CCC([N+])C([O-])=O" cannot be used as a page name in this wiki.