Difference between revisions of "CPD-8609"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8609 CPD-8609] == * smiles: ** CC(C)CCCC([CH]4(C1(C)(C(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)...") |
|||
Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** CC(C)CCCC([CH]4(C1(C)(C(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))=CC4)))C | ** CC(C)CCCC([CH]4(C1(C)(C(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))=CC4)))C | ||
− | |||
− | |||
− | |||
− | |||
* molecular weight: | * molecular weight: | ||
** 412.698 | ** 412.698 | ||
+ | * inchi key: | ||
+ | ** InChIKey=OGQJUYXFIOFTMA-PBJLWWPKSA-N | ||
+ | * common name: | ||
+ | ** 4,4-dimethyl-5-α-cholesta-8,14-dien-3-β-ol | ||
* Synonym(s): | * Synonym(s): | ||
Line 14: | Line 14: | ||
* [[RXN66-14]] | * [[RXN66-14]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
* [[RXN-13707]] | * [[RXN-13707]] | ||
+ | * [[RXN66-13]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | |||
− | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=78904 78904] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=78904 78904] | ||
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=167817 167817] | ||
{{#set: smiles=CC(C)CCCC([CH]4(C1(C)(C(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))=CC4)))C}} | {{#set: smiles=CC(C)CCCC([CH]4(C1(C)(C(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))=CC4)))C}} | ||
− | |||
− | |||
{{#set: molecular weight=412.698 }} | {{#set: molecular weight=412.698 }} | ||
+ | {{#set: inchi key=InChIKey=OGQJUYXFIOFTMA-PBJLWWPKSA-N}} | ||
+ | {{#set: common name=4,4-dimethyl-5-α-cholesta-8,14-dien-3-β-ol}} | ||
{{#set: consumed by=RXN66-14}} | {{#set: consumed by=RXN66-14}} | ||
− | {{#set: produced by= | + | {{#set: produced by=RXN-13707|RXN66-13}} |
Latest revision as of 13:37, 10 January 2019
Contents
Metabolite CPD-8609
- smiles:
- CC(C)CCCC([CH]4(C1(C)(C(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))=CC4)))C
- molecular weight:
- 412.698
- inchi key:
- InChIKey=OGQJUYXFIOFTMA-PBJLWWPKSA-N
- common name:
- 4,4-dimethyl-5-α-cholesta-8,14-dien-3-β-ol
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)CCCC([CH]4(C1(C)(C(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))=CC4)))C" cannot be used as a page name in this wiki.