Difference between revisions of "CPD-14133"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14133 CPD-14133] == * smiles: ** C5(N(C1(OC(C(C1O)O)COP(OP(OCC4(C(C(C(N3(C2(=C(C(=NC=N2)N)N...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C5(N(C1(OC(C(C1O)O)COP(OP(OCC4(C(C(C(N3(C2(=C(C(=NC=N2)N)N=C3)))O4)OP([O-])([O-])=O)O))([O-])=O)(=O)[O-]))C(O)CCC(C(=O)N)=5) | ** C5(N(C1(OC(C(C1O)O)COP(OP(OCC4(C(C(C(N3(C2(=C(C(=NC=N2)N)N=C3)))O4)OP([O-])([O-])=O)O))([O-])=O)(=O)[O-]))C(O)CCC(C(=O)N)=5) | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 759.41 | ** 759.41 | ||
| + | * inchi key: | ||
| + | ** InChIKey=SZKXTJUOKARGIY-MTKBYBFRSA-J | ||
| + | * common name: | ||
| + | ** (R)-NADPHX | ||
* Synonym(s): | * Synonym(s): | ||
| Line 16: | Line 16: | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | |||
| − | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=64077 64077] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=64077 64077] | ||
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=56927826 56927826] | ||
{{#set: smiles=C5(N(C1(OC(C(C1O)O)COP(OP(OCC4(C(C(C(N3(C2(=C(C(=NC=N2)N)N=C3)))O4)OP([O-])([O-])=O)O))([O-])=O)(=O)[O-]))C(O)CCC(C(=O)N)=5)}} | {{#set: smiles=C5(N(C1(OC(C(C1O)O)COP(OP(OCC4(C(C(C(N3(C2(=C(C(=NC=N2)N)N=C3)))O4)OP([O-])([O-])=O)O))([O-])=O)(=O)[O-]))C(O)CCC(C(=O)N)=5)}} | ||
| − | |||
| − | |||
{{#set: molecular weight=759.41 }} | {{#set: molecular weight=759.41 }} | ||
| + | {{#set: inchi key=InChIKey=SZKXTJUOKARGIY-MTKBYBFRSA-J}} | ||
| + | {{#set: common name=(R)-NADPHX}} | ||
{{#set: consumed by=RXN-13142}} | {{#set: consumed by=RXN-13142}} | ||
Latest revision as of 13:42, 10 January 2019
Contents
Metabolite CPD-14133
- smiles:
- C5(N(C1(OC(C(C1O)O)COP(OP(OCC4(C(C(C(N3(C2(=C(C(=NC=N2)N)N=C3)))O4)OP([O-])([O-])=O)O))([O-])=O)(=O)[O-]))C(O)CCC(C(=O)N)=5)
- molecular weight:
- 759.41
- inchi key:
- InChIKey=SZKXTJUOKARGIY-MTKBYBFRSA-J
- common name:
- (R)-NADPHX
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C5(N(C1(OC(C(C1O)O)COP(OP(OCC4(C(C(C(N3(C2(=C(C(=NC=N2)N)N=C3)))O4)OP([O-])([O-])=O)O))([O-])=O)(=O)[O-]))C(O)CCC(C(=O)N)=5)" cannot be used as a page name in this wiki.
