Difference between revisions of "CPD-7535"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7535 CPD-7535] == * smiles: ** CC(=CCCC(C)=CCCC(C)=CC=CC(=CC=CC=C(C=CC=C(CCC=C(CCC=C(C)C)C)...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** CC(=CCCC(C)=CCCC(C)=CC=CC(=CC=CC=C(C=CC=C(CCC=C(CCC=C(C)C)C)C)C)C)C | ** CC(=CCCC(C)=CCCC(C)=CC=CC(=CC=CC=C(C=CC=C(CCC=C(CCC=C(C)C)C)C)C)C)C | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 540.914 | ** 540.914 | ||
| + | * inchi key: | ||
| + | ** InChIKey=BIWLELKAFXRPDE-LMARSQGMSA-N | ||
| + | * common name: | ||
| + | ** 9,15,9'-tri-cis-ζ-carotene | ||
* Synonym(s): | * Synonym(s): | ||
** 9,15,9'-cis-ζ-carotene | ** 9,15,9'-cis-ζ-carotene | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-11355]] | ||
* [[RXN-12244]] | * [[RXN-12244]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | * [[RXN- | + | * [[RXN-11354]] |
== External links == | == External links == | ||
| − | |||
| − | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=48717 48717] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=48717 48717] | ||
* PUBCHEM: | * PUBCHEM: | ||
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=24755586 24755586] | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=24755586 24755586] | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C19764 C19764] | ||
{{#set: smiles=CC(=CCCC(C)=CCCC(C)=CC=CC(=CC=CC=C(C=CC=C(CCC=C(CCC=C(C)C)C)C)C)C)C}} | {{#set: smiles=CC(=CCCC(C)=CCCC(C)=CC=CC(=CC=CC=C(C=CC=C(CCC=C(CCC=C(C)C)C)C)C)C)C}} | ||
| − | |||
| − | |||
{{#set: molecular weight=540.914 }} | {{#set: molecular weight=540.914 }} | ||
| + | {{#set: inchi key=InChIKey=BIWLELKAFXRPDE-LMARSQGMSA-N}} | ||
| + | {{#set: common name=9,15,9'-tri-cis-ζ-carotene}} | ||
{{#set: common name=9,15,9'-cis-ζ-carotene}} | {{#set: common name=9,15,9'-cis-ζ-carotene}} | ||
| − | {{#set: | + | {{#set: produced by=RXN-11355|RXN-12244}} |
| − | + | {{#set: reversible reaction associated=RXN-11354}} | |
| − | {{#set: reversible reaction associated=RXN- | + | |
Latest revision as of 12:46, 10 January 2019
Contents
Metabolite CPD-7535
- smiles:
- CC(=CCCC(C)=CCCC(C)=CC=CC(=CC=CC=C(C=CC=C(CCC=C(CCC=C(C)C)C)C)C)C)C
- molecular weight:
- 540.914
- inchi key:
- InChIKey=BIWLELKAFXRPDE-LMARSQGMSA-N
- common name:
- 9,15,9'-tri-cis-ζ-carotene
- Synonym(s):
- 9,15,9'-cis-ζ-carotene
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
