Difference between revisions of "CPD-15425"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15425 CPD-15425] == * smiles: ** C([N+])C1(C(O)C(O)C(O)C(O1)OC2(C([N+])CC(C(C2O)OC3(OC(COC(...") |
|||
Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C([N+])C1(C(O)C(O)C(O)C(O1)OC2(C([N+])CC(C(C2O)OC3(OC(COC(=O)N)C(O)C([N+])C(O)3))[N+])) | ** C([N+])C1(C(O)C(O)C(O)C(O1)OC2(C([N+])CC(C(C2O)OC3(OC(COC(=O)N)C(O)C([N+])C(O)3))[N+])) | ||
− | |||
− | |||
− | |||
− | |||
* molecular weight: | * molecular weight: | ||
** 531.559 | ** 531.559 | ||
+ | * inchi key: | ||
+ | ** InChIKey=PRWQRPNQDIKFBR-NOAMYHISSA-R | ||
+ | * common name: | ||
+ | ** 6''-O-carbamoylkanamycin A | ||
* Synonym(s): | * Synonym(s): | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
* [[RXN-15285]] | * [[RXN-15285]] | ||
+ | * [[RXN-13167]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | |||
− | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=73675 73675] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=73675 73675] | ||
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=71464624 71464624] | ||
{{#set: smiles=C([N+])C1(C(O)C(O)C(O)C(O1)OC2(C([N+])CC(C(C2O)OC3(OC(COC(=O)N)C(O)C([N+])C(O)3))[N+]))}} | {{#set: smiles=C([N+])C1(C(O)C(O)C(O)C(O1)OC2(C([N+])CC(C(C2O)OC3(OC(COC(=O)N)C(O)C([N+])C(O)3))[N+]))}} | ||
− | |||
− | |||
{{#set: molecular weight=531.559 }} | {{#set: molecular weight=531.559 }} | ||
− | {{#set: produced by=RXN- | + | {{#set: inchi key=InChIKey=PRWQRPNQDIKFBR-NOAMYHISSA-R}} |
+ | {{#set: common name=6''-O-carbamoylkanamycin A}} | ||
+ | {{#set: produced by=RXN-15285|RXN-13167}} |
Latest revision as of 12:54, 10 January 2019
Contents
Metabolite CPD-15425
- smiles:
- C([N+])C1(C(O)C(O)C(O)C(O1)OC2(C([N+])CC(C(C2O)OC3(OC(COC(=O)N)C(O)C([N+])C(O)3))[N+]))
- molecular weight:
- 531.559
- inchi key:
- InChIKey=PRWQRPNQDIKFBR-NOAMYHISSA-R
- common name:
- 6-O-carbamoylkanamycin A
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C([N+])C1(C(O)C(O)C(O)C(O1)OC2(C([N+])CC(C(C2O)OC3(OC(COC(=O)N)C(O)C([N+])C(O)3))[N+]))" cannot be used as a page name in this wiki.