Difference between revisions of "CPD-18762"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18762 CPD-18762] == * smiles: ** CC(C)=CCCC(C)=CCCC(C)=CCC2(O)(C(C1(C=CC=CC=1[N+](=C(C)2)[O...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** CC(C)=CCCC(C)=CCCC(C)=CCC2(O)(C(C1(C=CC=CC=1[N+](=C(C)2)[O-]))=O) | ** CC(C)=CCCC(C)=CCCC(C)=CCC2(O)(C(C1(C=CC=CC=1[N+](=C(C)2)[O-]))=O) | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 395.541 | ** 395.541 | ||
| + | * inchi key: | ||
| + | ** InChIKey=HZBJGDKEAJESLM-YEFHWUCQSA-N | ||
| + | * common name: | ||
| + | ** 4-hydroxy-2-methyl-4-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trien-1-yl]quinolin-3(4H)-one 1-oxide | ||
* Synonym(s): | * Synonym(s): | ||
| Line 14: | Line 14: | ||
* [[RXN-17334]] | * [[RXN-17334]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=90890 90890] | ||
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=118796925 118796925] | ||
{{#set: smiles=CC(C)=CCCC(C)=CCCC(C)=CCC2(O)(C(C1(C=CC=CC=1[N+](=C(C)2)[O-]))=O)}} | {{#set: smiles=CC(C)=CCCC(C)=CCCC(C)=CCC2(O)(C(C1(C=CC=CC=1[N+](=C(C)2)[O-]))=O)}} | ||
| − | |||
| − | |||
{{#set: molecular weight=395.541 }} | {{#set: molecular weight=395.541 }} | ||
| + | {{#set: inchi key=InChIKey=HZBJGDKEAJESLM-YEFHWUCQSA-N}} | ||
| + | {{#set: common name=4-hydroxy-2-methyl-4-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trien-1-yl]quinolin-3(4H)-one 1-oxide}} | ||
{{#set: consumed by=RXN-17334}} | {{#set: consumed by=RXN-17334}} | ||
| − | |||
Latest revision as of 13:01, 10 January 2019
Contents
Metabolite CPD-18762
- smiles:
- CC(C)=CCCC(C)=CCCC(C)=CCC2(O)(C(C1(C=CC=CC=1[N+](=C(C)2)[O-]))=O)
- molecular weight:
- 395.541
- inchi key:
- InChIKey=HZBJGDKEAJESLM-YEFHWUCQSA-N
- common name:
- 4-hydroxy-2-methyl-4-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trien-1-yl]quinolin-3(4H)-one 1-oxide
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)=CCCC(C)=CCCC(C)=CCC2(O)(C(C1(C=CC=CC=1[N+](=C(C)2)[O-]))=O)" cannot be used as a page name in this wiki.
"4-hydroxy-2-methyl-4-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trien-1-yl]quinolin-3(4H)-one 1-oxide" cannot be used as a page name in this wiki.
