Difference between revisions of "ALA-GLY"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALA-GLY ALA-GLY] == * smiles: ** CC([N+])C(NCC([O-])=O)=O * common name: ** L-alanyl-glycine *...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** CC([N+])C(NCC([O-])=O)=O | ** CC([N+])C(NCC([O-])=O)=O | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 146.146 | ** 146.146 | ||
| + | * inchi key: | ||
| + | ** InChIKey=CXISPYVYMQWFLE-VKHMYHEASA-N | ||
| + | * common name: | ||
| + | ** L-alanyl-glycine | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** Ala-Gly |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| Line 17: | Line 17: | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| + | * METABOLIGHTS : MTBLC73786 | ||
* PUBCHEM: | * PUBCHEM: | ||
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6998028 6998028] | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6998028 6998028] | ||
| − | * | + | * HMDB : HMDB06899 |
| − | + | ||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=73786 73786] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=73786 73786] | ||
| − | * | + | * CHEMSPIDER: |
| − | * | + | ** [http://www.chemspider.com/Chemical-Structure.5365657.html 5365657] |
{{#set: smiles=CC([N+])C(NCC([O-])=O)=O}} | {{#set: smiles=CC([N+])C(NCC([O-])=O)=O}} | ||
| − | |||
| − | |||
{{#set: molecular weight=146.146 }} | {{#set: molecular weight=146.146 }} | ||
| − | {{#set: common name= | + | {{#set: inchi key=InChIKey=CXISPYVYMQWFLE-VKHMYHEASA-N}} |
| + | {{#set: common name=L-alanyl-glycine}} | ||
| + | {{#set: common name=Ala-Gly}} | ||
{{#set: consumed by=RXN0-6977}} | {{#set: consumed by=RXN0-6977}} | ||
Latest revision as of 13:04, 10 January 2019
Contents
Metabolite ALA-GLY
- smiles:
- CC([N+])C(NCC([O-])=O)=O
- molecular weight:
- 146.146
- inchi key:
- InChIKey=CXISPYVYMQWFLE-VKHMYHEASA-N
- common name:
- L-alanyl-glycine
- Synonym(s):
- Ala-Gly
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC([N+])C(NCC([O-])=O)=O" cannot be used as a page name in this wiki.
