Difference between revisions of "CPD-10663"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10663 CPD-10663] == * smiles: ** C(C1(C=C(Cl)C=CC=1O))([O-])=O * common name: ** 5-chlorosa...") |
|||
Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C(C1(C=C(Cl)C=CC=1O))([O-])=O | ** C(C1(C=C(Cl)C=CC=1O))([O-])=O | ||
− | |||
− | |||
− | |||
− | |||
* molecular weight: | * molecular weight: | ||
** 171.56 | ** 171.56 | ||
+ | * inchi key: | ||
+ | ** InChIKey=NKBASRXWGAGQDP-UHFFFAOYSA-M | ||
+ | * common name: | ||
+ | ** 5-chlorosalicylate | ||
* Synonym(s): | * Synonym(s): | ||
Line 16: | Line 16: | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | |||
− | |||
* CHEMSPIDER: | * CHEMSPIDER: | ||
** [http://www.chemspider.com/Chemical-Structure.5324206.html 5324206] | ** [http://www.chemspider.com/Chemical-Structure.5324206.html 5324206] | ||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=59131 59131] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=59131 59131] | ||
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=54706660 54706660] | ||
{{#set: smiles=C(C1(C=C(Cl)C=CC=1O))([O-])=O}} | {{#set: smiles=C(C1(C=C(Cl)C=CC=1O))([O-])=O}} | ||
− | |||
− | |||
{{#set: molecular weight=171.56 }} | {{#set: molecular weight=171.56 }} | ||
+ | {{#set: inchi key=InChIKey=NKBASRXWGAGQDP-UHFFFAOYSA-M}} | ||
+ | {{#set: common name=5-chlorosalicylate}} | ||
{{#set: consumed by=RXN-9914}} | {{#set: consumed by=RXN-9914}} |
Latest revision as of 14:08, 10 January 2019
Contents
Metabolite CPD-10663
- smiles:
- C(C1(C=C(Cl)C=CC=1O))([O-])=O
- molecular weight:
- 171.56
- inchi key:
- InChIKey=NKBASRXWGAGQDP-UHFFFAOYSA-M
- common name:
- 5-chlorosalicylate
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(C1(C=C(Cl)C=CC=1O))([O-])=O" cannot be used as a page name in this wiki.