Difference between revisions of "CPD-12124"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12124 CPD-12124] == * smiles: ** CC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC2(C(C)=C(O)...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** CC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC2(C(C)=C(O)C1(C=CC=CC=1C(O)=2)))C | ** CC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC2(C(C)=C(O)C1(C=CC=CC=1C(O)=2)))C | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 582.908 | ** 582.908 | ||
| + | * inchi key: | ||
| + | ** InChIKey=ZVENTDGZQVBWNA-RCIYGOBDSA-N | ||
| + | * common name: | ||
| + | ** menaquinol-6 | ||
* Synonym(s): | * Synonym(s): | ||
** menaquinol(6) | ** menaquinol(6) | ||
| Line 18: | Line 18: | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | |||
| − | |||
* CHEMSPIDER: | * CHEMSPIDER: | ||
** [http://www.chemspider.com/Chemical-Structure.4945264.html 4945264] | ** [http://www.chemspider.com/Chemical-Structure.4945264.html 4945264] | ||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=84536 84536] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=84536 84536] | ||
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6441040 6441040] | ||
{{#set: smiles=CC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC2(C(C)=C(O)C1(C=CC=CC=1C(O)=2)))C}} | {{#set: smiles=CC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC2(C(C)=C(O)C1(C=CC=CC=1C(O)=2)))C}} | ||
| − | |||
| − | |||
{{#set: molecular weight=582.908 }} | {{#set: molecular weight=582.908 }} | ||
| + | {{#set: inchi key=InChIKey=ZVENTDGZQVBWNA-RCIYGOBDSA-N}} | ||
| + | {{#set: common name=menaquinol-6}} | ||
{{#set: common name=menaquinol(6)|MKH2-6}} | {{#set: common name=menaquinol(6)|MKH2-6}} | ||
{{#set: produced by=RXN-9220}} | {{#set: produced by=RXN-9220}} | ||
Latest revision as of 13:15, 10 January 2019
Contents
Metabolite CPD-12124
- smiles:
- CC(=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCC2(C(C)=C(O)C1(C=CC=CC=1C(O)=2)))C
- molecular weight:
- 582.908
- inchi key:
- InChIKey=ZVENTDGZQVBWNA-RCIYGOBDSA-N
- common name:
- menaquinol-6
- Synonym(s):
- menaquinol(6)
- MKH2-6
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
