Difference between revisions of "CPD-7105"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7105 CPD-7105] == * smiles: ** CC(=CCC1(=C(C(=C(C(=C1[O-])CC=C(C)C)O)C(CC(C)C)=O)O))C * com...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** CC(=CCC1(=C(C(=C(C(=C1[O-])CC=C(C)C)O)C(CC(C)C)=O)O))C | ** CC(=CCC1(=C(C(=C(C(=C1[O-])CC=C(C)C)O)C(CC(C)C)=O)O))C | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 345.458 | ** 345.458 | ||
| − | * | + | * inchi key: |
| + | ** InChIKey=NQYBQBZOHCACCR-UHFFFAOYSA-M | ||
| + | * common name: | ||
** deoxyhumulone | ** deoxyhumulone | ||
| + | * Synonym(s): | ||
| + | ** diprenylphlorisovalerophenone | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| Line 20: | Line 20: | ||
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25203000 25203000] | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25203000 25203000] | ||
{{#set: smiles=CC(=CCC1(=C(C(=C(C(=C1[O-])CC=C(C)C)O)C(CC(C)C)=O)O))C}} | {{#set: smiles=CC(=CCC1(=C(C(=C(C(=C1[O-])CC=C(C)C)O)C(CC(C)C)=O)O))C}} | ||
| − | |||
| − | |||
{{#set: molecular weight=345.458 }} | {{#set: molecular weight=345.458 }} | ||
| + | {{#set: inchi key=InChIKey=NQYBQBZOHCACCR-UHFFFAOYSA-M}} | ||
{{#set: common name=deoxyhumulone}} | {{#set: common name=deoxyhumulone}} | ||
| + | {{#set: common name=diprenylphlorisovalerophenone}} | ||
{{#set: produced by=RXN-7810}} | {{#set: produced by=RXN-7810}} | ||
Latest revision as of 13:16, 10 January 2019
Contents
Metabolite CPD-7105
- smiles:
- CC(=CCC1(=C(C(=C(C(=C1[O-])CC=C(C)C)O)C(CC(C)C)=O)O))C
- molecular weight:
- 345.458
- inchi key:
- InChIKey=NQYBQBZOHCACCR-UHFFFAOYSA-M
- common name:
- deoxyhumulone
- Synonym(s):
- diprenylphlorisovalerophenone
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"CC(=CCC1(=C(C(=C(C(=C1[O-])CC=C(C)C)O)C(CC(C)C)=O)O))C" cannot be used as a page name in this wiki.
