Difference between revisions of "CPD-602"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-602 CPD-602] == * smiles: ** C(OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)NC2(=C(N)C(=O)NC(=O)N2)) *...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C(OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)NC2(=C(N)C(=O)NC(=O)N2)) | ** C(OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)NC2(=C(N)C(=O)NC(=O)N2)) | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 352.197 | ** 352.197 | ||
| + | * inchi key: | ||
| + | ** InChIKey=LZEXYCAGPMYXLX-UMMCILCDSA-L | ||
| + | * common name: | ||
| + | ** 5-amino-6-(5-phospho-D-ribosylamino)uracil | ||
* Synonym(s): | * Synonym(s): | ||
** 5-amino-6-(ribosylamino)-2,4-(1H,3H)-pyrimidinedione 5'-phosphate | ** 5-amino-6-(ribosylamino)-2,4-(1H,3H)-pyrimidinedione 5'-phosphate | ||
| Line 19: | Line 19: | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | |||
| − | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58453 58453] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58453 58453] | ||
| − | * | + | * PUBCHEM: |
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245199 25245199] | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
** [http://www.genome.jp/dbget-bin/www_bget?C01268 C01268] | ** [http://www.genome.jp/dbget-bin/www_bget?C01268 C01268] | ||
| + | * BIGG : 5apru | ||
{{#set: smiles=C(OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)NC2(=C(N)C(=O)NC(=O)N2))}} | {{#set: smiles=C(OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)NC2(=C(N)C(=O)NC(=O)N2))}} | ||
| − | |||
| − | |||
{{#set: molecular weight=352.197 }} | {{#set: molecular weight=352.197 }} | ||
| + | {{#set: inchi key=InChIKey=LZEXYCAGPMYXLX-UMMCILCDSA-L}} | ||
| + | {{#set: common name=5-amino-6-(5-phospho-D-ribosylamino)uracil}} | ||
{{#set: common name=5-amino-6-(ribosylamino)-2,4-(1H,3H)-pyrimidinedione 5'-phosphate|5-amino-6-(5'-phosphoribosylamino)uracil}} | {{#set: common name=5-amino-6-(ribosylamino)-2,4-(1H,3H)-pyrimidinedione 5'-phosphate|5-amino-6-(5'-phosphoribosylamino)uracil}} | ||
{{#set: consumed by=RIBOFLAVINSYNREDUC-RXN}} | {{#set: consumed by=RIBOFLAVINSYNREDUC-RXN}} | ||
{{#set: produced by=RIBOFLAVINSYNDEAM-RXN}} | {{#set: produced by=RIBOFLAVINSYNDEAM-RXN}} | ||
Latest revision as of 13:19, 10 January 2019
Contents
Metabolite CPD-602
- smiles:
- C(OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)NC2(=C(N)C(=O)NC(=O)N2))
- molecular weight:
- 352.197
- inchi key:
- InChIKey=LZEXYCAGPMYXLX-UMMCILCDSA-L
- common name:
- 5-amino-6-(5-phospho-D-ribosylamino)uracil
- Synonym(s):
- 5-amino-6-(ribosylamino)-2,4-(1H,3H)-pyrimidinedione 5'-phosphate
- 5-amino-6-(5'-phosphoribosylamino)uracil
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)NC2(=C(N)C(=O)NC(=O)N2))" cannot be used as a page name in this wiki.
