Difference between revisions of "CPD-4617"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4617 CPD-4617] == * smiles: ** CC(CCNC1(C2(=C(N=CN=1)NC=N2)))COC3(C(C(C(C(O3)CO)O)O)O) * co...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** CC(CCNC1(C2(=C(N=CN=1)NC=N2)))COC3(C(C(C(C(O3)CO)O)O)O) | ** CC(CCNC1(C2(=C(N=CN=1)NC=N2)))COC3(C(C(C(C(O3)CO)O)O)O) | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 383.403 | ** 383.403 | ||
| + | * inchi key: | ||
| + | ** InChIKey=QRZHDHJUYBONQQ-JSYMRTRDSA-N | ||
| + | * common name: | ||
| + | ** dihydrozeatin-O-glucoside | ||
* Synonym(s): | * Synonym(s): | ||
| Line 22: | Line 22: | ||
** [http://www.genome.jp/dbget-bin/www_bget?C16448 C16448] | ** [http://www.genome.jp/dbget-bin/www_bget?C16448 C16448] | ||
{{#set: smiles=CC(CCNC1(C2(=C(N=CN=1)NC=N2)))COC3(C(C(C(C(O3)CO)O)O)O)}} | {{#set: smiles=CC(CCNC1(C2(=C(N=CN=1)NC=N2)))COC3(C(C(C(C(O3)CO)O)O)O)}} | ||
| − | |||
| − | |||
{{#set: molecular weight=383.403 }} | {{#set: molecular weight=383.403 }} | ||
| + | {{#set: inchi key=InChIKey=QRZHDHJUYBONQQ-JSYMRTRDSA-N}} | ||
| + | {{#set: common name=dihydrozeatin-O-glucoside}} | ||
{{#set: produced by=RXN-4726}} | {{#set: produced by=RXN-4726}} | ||
Latest revision as of 13:20, 10 January 2019
Contents
Metabolite CPD-4617
- smiles:
- CC(CCNC1(C2(=C(N=CN=1)NC=N2)))COC3(C(C(C(C(O3)CO)O)O)O)
- molecular weight:
- 383.403
- inchi key:
- InChIKey=QRZHDHJUYBONQQ-JSYMRTRDSA-N
- common name:
- dihydrozeatin-O-glucoside
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
