Difference between revisions of "CPD-6661"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6661 CPD-6661] == * smiles: ** C1(O)(C(OP([O-])(=O)[O-])C(OP([O-])([O-])=O)C(OP([O-])([O-])...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C1(O)(C(OP([O-])(=O)[O-])C(OP([O-])([O-])=O)C(OP([O-])([O-])=O)C(OP(=O)([O-])[O-])C(OP(=O)([O-])[O-])1) | ** C1(O)(C(OP([O-])(=O)[O-])C(OP([O-])([O-])=O)C(OP([O-])([O-])=O)C(OP(=O)([O-])[O-])C(OP(=O)([O-])[O-])1) | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 569.977 | ** 569.977 | ||
| + | * inchi key: | ||
| + | ** InChIKey=CTPQAXVNYGZUAJ-QWBQGLJISA-D | ||
| + | * common name: | ||
| + | ** 1D-myo-inositol (1,2,3,4,6)-pentakisphosphate | ||
* Synonym(s): | * Synonym(s): | ||
** Ins(1,2,3,4,6)P5 | ** Ins(1,2,3,4,6)P5 | ||
| Line 19: | Line 19: | ||
* [[RXN-7186]] | * [[RXN-7186]] | ||
== External links == | == External links == | ||
| − | |||
| − | |||
* CHEMSPIDER: | * CHEMSPIDER: | ||
** [http://www.chemspider.com/Chemical-Structure.19951265.html 19951265] | ** [http://www.chemspider.com/Chemical-Structure.19951265.html 19951265] | ||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57257 57257] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57257 57257] | ||
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=23615305 23615305] | ||
{{#set: smiles=C1(O)(C(OP([O-])(=O)[O-])C(OP([O-])([O-])=O)C(OP([O-])([O-])=O)C(OP(=O)([O-])[O-])C(OP(=O)([O-])[O-])1)}} | {{#set: smiles=C1(O)(C(OP([O-])(=O)[O-])C(OP([O-])([O-])=O)C(OP([O-])([O-])=O)C(OP(=O)([O-])[O-])C(OP(=O)([O-])[O-])1)}} | ||
| − | |||
| − | |||
{{#set: molecular weight=569.977 }} | {{#set: molecular weight=569.977 }} | ||
| + | {{#set: inchi key=InChIKey=CTPQAXVNYGZUAJ-QWBQGLJISA-D}} | ||
| + | {{#set: common name=1D-myo-inositol (1,2,3,4,6)-pentakisphosphate}} | ||
{{#set: common name=Ins(1,2,3,4,6)P5|D-myo-inositol (1,2,3,4,6)-pentakisphosphate|inositol (1,2,3,4,6)-pentakisphosphate}} | {{#set: common name=Ins(1,2,3,4,6)P5|D-myo-inositol (1,2,3,4,6)-pentakisphosphate|inositol (1,2,3,4,6)-pentakisphosphate}} | ||
{{#set: reversible reaction associated=RXN-7186}} | {{#set: reversible reaction associated=RXN-7186}} | ||
Latest revision as of 13:21, 10 January 2019
Contents
Metabolite CPD-6661
- smiles:
- C1(O)(C(OP([O-])(=O)[O-])C(OP([O-])([O-])=O)C(OP([O-])([O-])=O)C(OP(=O)([O-])[O-])C(OP(=O)([O-])[O-])1)
- molecular weight:
- 569.977
- inchi key:
- InChIKey=CTPQAXVNYGZUAJ-QWBQGLJISA-D
- common name:
- 1D-myo-inositol (1,2,3,4,6)-pentakisphosphate
- Synonym(s):
- Ins(1,2,3,4,6)P5
- D-myo-inositol (1,2,3,4,6)-pentakisphosphate
- inositol (1,2,3,4,6)-pentakisphosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C1(O)(C(OP([O-])(=O)[O-])C(OP([O-])([O-])=O)C(OP([O-])([O-])=O)C(OP(=O)([O-])[O-])C(OP(=O)([O-])[O-])1)" cannot be used as a page name in this wiki.
