Difference between revisions of "CPD-9066"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9066 CPD-9066] == * smiles: ** CCC5(C(C)C9(N6([Mg]27(N1(C(C(C)C(CCC(=O)[O-])C=1C4([C-](C(OC...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** CCC5(C(C)C9(N6([Mg]27(N1(C(C(C)C(CCC(=O)[O-])C=1C4([C-](C(OC)=O)C(=O)C3(=C(C)C(N2C3=4)=CC5=6)))=CC8(=C(C)C(C(C)=O)=C(N78)C=9)))))) | ** CCC5(C(C)C9(N6([Mg]27(N1(C(C(C)C(CCC(=O)[O-])C=1C4([C-](C(OC)=O)C(=O)C3(=C(C)C(N2C3=4)=CC5=6)))=CC8(=C(C)C(C(C)=O)=C(N78)C=9)))))) | ||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 630.982 | ** 630.982 | ||
| + | * common name: | ||
| + | ** bacteriochlorophyllide a | ||
* Synonym(s): | * Synonym(s): | ||
| Line 15: | Line 15: | ||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=122706160 122706160] |
{{#set: smiles=CCC5(C(C)C9(N6([Mg]27(N1(C(C(C)C(CCC(=O)[O-])C=1C4([C-](C(OC)=O)C(=O)C3(=C(C)C(N2C3=4)=CC5=6)))=CC8(=C(C)C(C(C)=O)=C(N78)C=9))))))}} | {{#set: smiles=CCC5(C(C)C9(N6([Mg]27(N1(C(C(C)C(CCC(=O)[O-])C=1C4([C-](C(OC)=O)C(=O)C3(=C(C)C(N2C3=4)=CC5=6)))=CC8(=C(C)C(C(C)=O)=C(N78)C=9))))))}} | ||
| − | |||
{{#set: molecular weight=630.982 }} | {{#set: molecular weight=630.982 }} | ||
| + | {{#set: common name=bacteriochlorophyllide a}} | ||
{{#set: consumed by=RXN-8788}} | {{#set: consumed by=RXN-8788}} | ||
Latest revision as of 13:23, 10 January 2019
Contents
Metabolite CPD-9066
- smiles:
- CCC5(C(C)C9(N6([Mg]27(N1(C(C(C)C(CCC(=O)[O-])C=1C4([C-](C(OC)=O)C(=O)C3(=C(C)C(N2C3=4)=CC5=6)))=CC8(=C(C)C(C(C)=O)=C(N78)C=9))))))
- molecular weight:
- 630.982
- common name:
- bacteriochlorophyllide a
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"CCC5(C(C)C9(N6([Mg]27(N1(C(C(C)C(CCC(=O)[O-])C=1C4([C-](C(OC)=O)C(=O)C3(=C(C)C(N2C3=4)=CC5=6)))=CC8(=C(C)C(C(C)=O)=C(N78)C=9))))))" cannot be used as a page name in this wiki.
