Difference between revisions of "S-PRENYL-L-CYSTEINE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-PRENYL-L-CYSTEINE S-PRENYL-L-CYSTEINE] == * smiles: ** CC(C)=CCSCC([N+])C(=O)[O-] * common na...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** CC(C)=CCSCC([N+])C(=O)[O-] | ** CC(C)=CCSCC([N+])C(=O)[O-] | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 189.272 | ** 189.272 | ||
| + | * inchi key: | ||
| + | ** InChIKey=ULHWZNASVJIOEM-ZETCQYMHSA-N | ||
| + | * common name: | ||
| + | ** S-prenyl-L-cysteine | ||
* Synonym(s): | * Synonym(s): | ||
** prenyl-L-cysteine | ** prenyl-L-cysteine | ||
| Line 17: | Line 17: | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| + | * REFMET : S-prenyl-L-cysteine | ||
* PUBCHEM: | * PUBCHEM: | ||
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25200435 25200435] | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25200435 25200435] | ||
* HMDB : HMDB12286 | * HMDB : HMDB12286 | ||
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=136985 136985] |
* LIGAND-CPD: | * LIGAND-CPD: | ||
** [http://www.genome.jp/dbget-bin/www_bget?C06751 C06751] | ** [http://www.genome.jp/dbget-bin/www_bget?C06751 C06751] | ||
{{#set: smiles=CC(C)=CCSCC([N+])C(=O)[O-]}} | {{#set: smiles=CC(C)=CCSCC([N+])C(=O)[O-]}} | ||
| − | |||
| − | |||
{{#set: molecular weight=189.272 }} | {{#set: molecular weight=189.272 }} | ||
| + | {{#set: inchi key=InChIKey=ULHWZNASVJIOEM-ZETCQYMHSA-N}} | ||
| + | {{#set: common name=S-prenyl-L-cysteine}} | ||
{{#set: common name=prenyl-L-cysteine}} | {{#set: common name=prenyl-L-cysteine}} | ||
{{#set: consumed by=1.8.3.5-RXN}} | {{#set: consumed by=1.8.3.5-RXN}} | ||
Latest revision as of 13:27, 10 January 2019
Contents
Metabolite S-PRENYL-L-CYSTEINE
- smiles:
- CC(C)=CCSCC([N+])C(=O)[O-]
- molecular weight:
- 189.272
- inchi key:
- InChIKey=ULHWZNASVJIOEM-ZETCQYMHSA-N
- common name:
- S-prenyl-L-cysteine
- Synonym(s):
- prenyl-L-cysteine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)=CCSCC([N+])C(=O)[O-" cannot be used as a page name in this wiki.
