Difference between revisions of "CPD-10664"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10664 CPD-10664] == * smiles: ** CC1(=CC(=C(C=C1)O)C([O-])=O) * common name: ** 5-methylsal...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** CC1(=CC(=C(C=C1)O)C([O-])=O) | ** CC1(=CC(=C(C=C1)O)C([O-])=O) | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 151.141 | ** 151.141 | ||
| + | * inchi key: | ||
| + | ** InChIKey=DLGBEGBHXSAQOC-UHFFFAOYSA-M | ||
| + | * common name: | ||
| + | ** 5-methylsalicylate | ||
* Synonym(s): | * Synonym(s): | ||
| Line 16: | Line 16: | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | |||
| − | |||
* CHEMSPIDER: | * CHEMSPIDER: | ||
** [http://www.chemspider.com/Chemical-Structure.5323120.html 5323120] | ** [http://www.chemspider.com/Chemical-Structure.5323120.html 5323120] | ||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=309332 309332] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=309332 309332] | ||
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=54706644 54706644] | ||
{{#set: smiles=CC1(=CC(=C(C=C1)O)C([O-])=O)}} | {{#set: smiles=CC1(=CC(=C(C=C1)O)C([O-])=O)}} | ||
| − | |||
| − | |||
{{#set: molecular weight=151.141 }} | {{#set: molecular weight=151.141 }} | ||
| + | {{#set: inchi key=InChIKey=DLGBEGBHXSAQOC-UHFFFAOYSA-M}} | ||
| + | {{#set: common name=5-methylsalicylate}} | ||
{{#set: consumed by=RXN-10079}} | {{#set: consumed by=RXN-10079}} | ||
Latest revision as of 13:29, 10 January 2019
Contents
Metabolite CPD-10664
- smiles:
- CC1(=CC(=C(C=C1)O)C([O-])=O)
- molecular weight:
- 151.141
- inchi key:
- InChIKey=DLGBEGBHXSAQOC-UHFFFAOYSA-M
- common name:
- 5-methylsalicylate
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC1(=CC(=C(C=C1)O)C([O-])=O)" cannot be used as a page name in this wiki.
