Difference between revisions of "DIAMINO-OH-PHOSPHORIBOSYLAMINO-PYR"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIAMINO-OH-PHOSPHORIBOSYLAMINO-PYR DIAMINO-OH-PHOSPHORIBOSYLAMINO-PYR] == * smiles: ** C(C2(C(O...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C(C2(C(O)C(O)C(NC1(=C(N)C(=O)NC(=N1)N))O2))OP(=O)([O-])[O-] | ** C(C2(C(O)C(O)C(NC1(=C(N)C(=O)NC(=N1)N))O2))OP(=O)([O-])[O-] | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 351.212 | ** 351.212 | ||
| + | * inchi key: | ||
| + | ** InChIKey=OCLCLRXKNJCOJD-UMMCILCDSA-L | ||
| + | * common name: | ||
| + | ** 2,5-diamino-6-(5-phospho-D-ribosylamino)pyrimidin-4(3H)-one | ||
* Synonym(s): | * Synonym(s): | ||
** 2,5-diamino-6-hydroxy-4-(5-phosphoribosylamino)pyrimidine | ** 2,5-diamino-6-hydroxy-4-(5-phosphoribosylamino)pyrimidine | ||
| Line 17: | Line 17: | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
* [[RXN-10057]] | * [[RXN-10057]] | ||
| + | * [[RIBOFLAVINSYNDEAM-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
* [[GTP-CYCLOHYDRO-II-RXN]] | * [[GTP-CYCLOHYDRO-II-RXN]] | ||
| Line 24: | Line 24: | ||
* [[RXN-14171]] | * [[RXN-14171]] | ||
== External links == | == External links == | ||
| − | |||
| − | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=29114 29114] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=29114 29114] | ||
| − | * | + | * PUBCHEM: |
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244331 25244331] | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
** [http://www.genome.jp/dbget-bin/www_bget?C01304 C01304] | ** [http://www.genome.jp/dbget-bin/www_bget?C01304 C01304] | ||
| + | * BIGG : 25drapp | ||
{{#set: smiles=C(C2(C(O)C(O)C(NC1(=C(N)C(=O)NC(=N1)N))O2))OP(=O)([O-])[O-]}} | {{#set: smiles=C(C2(C(O)C(O)C(NC1(=C(N)C(=O)NC(=N1)N))O2))OP(=O)([O-])[O-]}} | ||
| − | |||
| − | |||
{{#set: molecular weight=351.212 }} | {{#set: molecular weight=351.212 }} | ||
| + | {{#set: inchi key=InChIKey=OCLCLRXKNJCOJD-UMMCILCDSA-L}} | ||
| + | {{#set: common name=2,5-diamino-6-(5-phospho-D-ribosylamino)pyrimidin-4(3H)-one}} | ||
{{#set: common name=2,5-diamino-6-hydroxy-4-(5-phosphoribosylamino)pyrimidine|DARP|2,5-diamino-6-(1-D-ribosylamino)pyrimidin-4(3H)-one 5'-phosphate|2,5-diamino-6-(ribosylamino)-4-(3H)-pyrimidinone 5'-phosphate|2,5-diamino-6-(D-ribosylamino)pyrimidin-4(3H)-one 5'-phosphate}} | {{#set: common name=2,5-diamino-6-hydroxy-4-(5-phosphoribosylamino)pyrimidine|DARP|2,5-diamino-6-(1-D-ribosylamino)pyrimidin-4(3H)-one 5'-phosphate|2,5-diamino-6-(ribosylamino)-4-(3H)-pyrimidinone 5'-phosphate|2,5-diamino-6-(D-ribosylamino)pyrimidin-4(3H)-one 5'-phosphate}} | ||
| − | {{#set: consumed by= | + | {{#set: consumed by=RXN-10057|RIBOFLAVINSYNDEAM-RXN}} |
{{#set: produced by=GTP-CYCLOHYDRO-II-RXN}} | {{#set: produced by=GTP-CYCLOHYDRO-II-RXN}} | ||
{{#set: reversible reaction associated=RXN-14171}} | {{#set: reversible reaction associated=RXN-14171}} | ||
Latest revision as of 13:31, 10 January 2019
Contents
Metabolite DIAMINO-OH-PHOSPHORIBOSYLAMINO-PYR
- smiles:
- C(C2(C(O)C(O)C(NC1(=C(N)C(=O)NC(=N1)N))O2))OP(=O)([O-])[O-]
- molecular weight:
- 351.212
- inchi key:
- InChIKey=OCLCLRXKNJCOJD-UMMCILCDSA-L
- common name:
- 2,5-diamino-6-(5-phospho-D-ribosylamino)pyrimidin-4(3H)-one
- Synonym(s):
- 2,5-diamino-6-hydroxy-4-(5-phosphoribosylamino)pyrimidine
- DARP
- 2,5-diamino-6-(1-D-ribosylamino)pyrimidin-4(3H)-one 5'-phosphate
- 2,5-diamino-6-(ribosylamino)-4-(3H)-pyrimidinone 5'-phosphate
- 2,5-diamino-6-(D-ribosylamino)pyrimidin-4(3H)-one 5'-phosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(C2(C(O)C(O)C(NC1(=C(N)C(=O)NC(=N1)N))O2))OP(=O)([O-])[O-" cannot be used as a page name in this wiki.
