Difference between revisions of "CPD-1825"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1825 CPD-1825] == * smiles: ** C1(OC(C(C(C1O)O)O)OP([O-])([O-])=O) * common name: ** β...") |
|||
| Line 2: | Line 2: | ||
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1825 CPD-1825] == | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1825 CPD-1825] == | ||
* smiles: | * smiles: | ||
| − | ** C1(OC(C(C(C1O)O)O)OP([O-])([O-]) | + | ** C1(OC(C(C(C1O)O)O)OP([O-])(=O)[O-]) |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* molecular weight: | * molecular weight: | ||
** 228.095 | ** 228.095 | ||
| + | * inchi key: | ||
| + | ** InChIKey=ILXHFXFPPZGENN-QMKXCQHVSA-L | ||
| + | * common name: | ||
| + | ** β-L-arabinose 1-phosphate | ||
* Synonym(s): | * Synonym(s): | ||
** β-L-arabinose 1-P | ** β-L-arabinose 1-P | ||
| Line 17: | Line 17: | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57521 57521] | ||
* PUBCHEM: | * PUBCHEM: | ||
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244737 25244737] | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244737 25244737] | ||
* HMDB : HMDB12195 | * HMDB : HMDB12195 | ||
| − | |||
| − | |||
* LIGAND-CPD: | * LIGAND-CPD: | ||
** [http://www.genome.jp/dbget-bin/www_bget?C03906 C03906] | ** [http://www.genome.jp/dbget-bin/www_bget?C03906 C03906] | ||
| − | {{#set: smiles=C1(OC(C(C(C1O)O)O)OP([O-])([O-]) | + | {{#set: smiles=C1(OC(C(C(C1O)O)O)OP([O-])(=O)[O-])}} |
| − | + | ||
| − | + | ||
{{#set: molecular weight=228.095 }} | {{#set: molecular weight=228.095 }} | ||
| + | {{#set: inchi key=InChIKey=ILXHFXFPPZGENN-QMKXCQHVSA-L}} | ||
| + | {{#set: common name=β-L-arabinose 1-phosphate}} | ||
{{#set: common name=β-L-arabinose 1-P}} | {{#set: common name=β-L-arabinose 1-P}} | ||
{{#set: consumed by=UMPU}} | {{#set: consumed by=UMPU}} | ||
Latest revision as of 13:32, 10 January 2019
Contents
Metabolite CPD-1825
- smiles:
- C1(OC(C(C(C1O)O)O)OP([O-])(=O)[O-])
- molecular weight:
- 228.095
- inchi key:
- InChIKey=ILXHFXFPPZGENN-QMKXCQHVSA-L
- common name:
- β-L-arabinose 1-phosphate
- Synonym(s):
- β-L-arabinose 1-P
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C1(OC(C(C(C1O)O)O)OP([O-])(=O)[O-])" cannot be used as a page name in this wiki.
