Difference between revisions of "PROTOHEME"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PROTOHEME PROTOHEME] == * smiles: ** C=CC1(C(C)=C7(C=C8(C(C)=C(CCC(=O)[O-])C6(=[N+]([Fe--]24(N(...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C=CC1(C(C)=C7(C=C8(C(C)=C(CCC(=O)[O-])C6(=[N+]([Fe--]24(N(C=1C=C3(C(C)=C(C=C)C(=[N+]23)C=C5(C(C)=C(CCC(=O)[O-])C(N45)=C6)))7))8)))) | ** C=CC1(C(C)=C7(C=C8(C(C)=C(CCC(=O)[O-])C6(=[N+]([Fe--]24(N(C=1C=C3(C(C)=C(C=C)C(=[N+]23)C=C5(C(C)=C(CCC(=O)[O-])C(N45)=C6)))7))8)))) | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 614.482 | ** 614.482 | ||
| + | * inchi key: | ||
| + | ** InChIKey=KABFMIBPWCXCRK-RGGAHWMASA-J | ||
| + | * common name: | ||
| + | ** ferroheme b | ||
* Synonym(s): | * Synonym(s): | ||
** protoheme IX | ** protoheme IX | ||
| Line 14: | Line 14: | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[HEMEOSYN-RXN]] | ||
* [[HEME-OXYGENASE-DECYCLIZING-RXN]] | * [[HEME-OXYGENASE-DECYCLIZING-RXN]] | ||
* [[RXN-17523]] | * [[RXN-17523]] | ||
| Line 20: | Line 21: | ||
* [[PROTOHEMEFERROCHELAT-RXN]] | * [[PROTOHEMEFERROCHELAT-RXN]] | ||
== External links == | == External links == | ||
| + | * REFMET : Heme | ||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17627 17627] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17627 17627] | ||
* BIGG : pheme | * BIGG : pheme | ||
{{#set: smiles=C=CC1(C(C)=C7(C=C8(C(C)=C(CCC(=O)[O-])C6(=[N+]([Fe--]24(N(C=1C=C3(C(C)=C(C=C)C(=[N+]23)C=C5(C(C)=C(CCC(=O)[O-])C(N45)=C6)))7))8))))}} | {{#set: smiles=C=CC1(C(C)=C7(C=C8(C(C)=C(CCC(=O)[O-])C6(=[N+]([Fe--]24(N(C=1C=C3(C(C)=C(C=C)C(=[N+]23)C=C5(C(C)=C(CCC(=O)[O-])C(N45)=C6)))7))8))))}} | ||
| − | |||
| − | |||
{{#set: molecular weight=614.482 }} | {{#set: molecular weight=614.482 }} | ||
| + | {{#set: inchi key=InChIKey=KABFMIBPWCXCRK-RGGAHWMASA-J}} | ||
| + | {{#set: common name=ferroheme b}} | ||
{{#set: common name=protoheme IX|ferroprotoporphyrin IX}} | {{#set: common name=protoheme IX|ferroprotoporphyrin IX}} | ||
| − | {{#set: consumed by=HEME-OXYGENASE-DECYCLIZING-RXN|RXN-17523}} | + | {{#set: consumed by=HEMEOSYN-RXN|HEME-OXYGENASE-DECYCLIZING-RXN|RXN-17523}} |
{{#set: reversible reaction associated=PROTOHEMEFERROCHELAT-RXN}} | {{#set: reversible reaction associated=PROTOHEMEFERROCHELAT-RXN}} | ||
Latest revision as of 13:36, 10 January 2019
Contents
Metabolite PROTOHEME
- smiles:
- C=CC1(C(C)=C7(C=C8(C(C)=C(CCC(=O)[O-])C6(=[N+]([Fe--]24(N(C=1C=C3(C(C)=C(C=C)C(=[N+]23)C=C5(C(C)=C(CCC(=O)[O-])C(N45)=C6)))7))8))))
- molecular weight:
- 614.482
- inchi key:
- InChIKey=KABFMIBPWCXCRK-RGGAHWMASA-J
- common name:
- ferroheme b
- Synonym(s):
- protoheme IX
- ferroprotoporphyrin IX
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- REFMET : Heme
- CHEBI:
- BIGG : pheme
"C=CC1(C(C)=C7(C=C8(C(C)=C(CCC(=O)[O-])C6(=[N+]([Fe--]24(N(C=1C=C3(C(C)=C(C=C)C(=[N+]23)C=C5(C(C)=C(CCC(=O)[O-])C(N45)=C6)))7))8))))" cannot be used as a page name in this wiki.
