Difference between revisions of "CPD-1121"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1121 CPD-1121] == * smiles: ** C2(O)(C(O)C1(OP([O-])(=O)OC1C(O)C(O)2)) * common name: ** D-...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C2(O)(C(O)C1(OP([O-])(=O)OC1C(O)C(O)2)) | ** C2(O)(C(O)C1(OP([O-])(=O)OC1C(O)C(O)2)) | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 241.114 | ** 241.114 | ||
| + | * inchi key: | ||
| + | ** InChIKey=SXHMVNXROAUURW-FTYOSCRSSA-M | ||
| + | * common name: | ||
| + | ** D-myo-inositol 1,2-cyclic phosphate | ||
* Synonym(s): | * Synonym(s): | ||
** 1D-myo-inositol 1,2-cyclic phosphate | ** 1D-myo-inositol 1,2-cyclic phosphate | ||
| Line 17: | Line 17: | ||
* [[3.1.4.10-RXN]] | * [[3.1.4.10-RXN]] | ||
== External links == | == External links == | ||
| − | |||
* PUBCHEM: | * PUBCHEM: | ||
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202140 25202140] | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202140 25202140] | ||
| − | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58484 58484] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58484 58484] | ||
| + | * GO-TERMS : (REFMET "Inositol cyclic phosphate" NIL midford 3701443689 NIL NIL) | ||
| + | * CAS : 43119-57-9 | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
** [http://www.genome.jp/dbget-bin/www_bget?C04299 C04299] | ** [http://www.genome.jp/dbget-bin/www_bget?C04299 C04299] | ||
| + | * HMDB : HMDB01125 | ||
{{#set: smiles=C2(O)(C(O)C1(OP([O-])(=O)OC1C(O)C(O)2))}} | {{#set: smiles=C2(O)(C(O)C1(OP([O-])(=O)OC1C(O)C(O)2))}} | ||
| − | |||
| − | |||
{{#set: molecular weight=241.114 }} | {{#set: molecular weight=241.114 }} | ||
| + | {{#set: inchi key=InChIKey=SXHMVNXROAUURW-FTYOSCRSSA-M}} | ||
| + | {{#set: common name=D-myo-inositol 1,2-cyclic phosphate}} | ||
{{#set: common name=1D-myo-inositol 1,2-cyclic phosphate}} | {{#set: common name=1D-myo-inositol 1,2-cyclic phosphate}} | ||
{{#set: reversible reaction associated=3.1.4.10-RXN}} | {{#set: reversible reaction associated=3.1.4.10-RXN}} | ||
Latest revision as of 13:36, 10 January 2019
Contents
Metabolite CPD-1121
- smiles:
- C2(O)(C(O)C1(OP([O-])(=O)OC1C(O)C(O)2))
- molecular weight:
- 241.114
- inchi key:
- InChIKey=SXHMVNXROAUURW-FTYOSCRSSA-M
- common name:
- D-myo-inositol 1,2-cyclic phosphate
- Synonym(s):
- 1D-myo-inositol 1,2-cyclic phosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
- CHEBI:
- GO-TERMS : (REFMET "Inositol cyclic phosphate" NIL midford 3701443689 NIL NIL)
- CAS : 43119-57-9
- LIGAND-CPD:
- HMDB : HMDB01125
"C2(O)(C(O)C1(OP([O-])(=O)OC1C(O)C(O)2))" cannot be used as a page name in this wiki.
