Difference between revisions of "CPD-9858"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9858 CPD-9858] == * smiles: ** CC(C)=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(C(=C(OC)C=C(C...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** CC(C)=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(C(=C(OC)C=C(C=1)O)O))C)C)C)C)C)C | ** CC(C)=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(C(=C(OC)C=C(C=1)O)O))C)C)C)C)C)C | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 616.966 | ** 616.966 | ||
| + | * inchi key: | ||
| + | ** InChIKey=WEGXYVFDOLUULO-TUUMQRACSA-N | ||
| + | * common name: | ||
| + | ** 2-methoxy-6-all trans-heptaprenyl-1,4-benzoquinol | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** 2-methoxy-6-heptaprenyl | + | ** 2-methoxy-6-heptaprenyl-1,4-benzoquinol |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| Line 17: | Line 17: | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | |||
| − | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=84528 84528] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=84528 84528] | ||
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=50986202 50986202] | ||
{{#set: smiles=CC(C)=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(C(=C(OC)C=C(C=1)O)O))C)C)C)C)C)C}} | {{#set: smiles=CC(C)=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(C(=C(OC)C=C(C=1)O)O))C)C)C)C)C)C}} | ||
| − | |||
| − | |||
{{#set: molecular weight=616.966 }} | {{#set: molecular weight=616.966 }} | ||
| − | {{#set: common name=2-methoxy-6-heptaprenyl-2-methoxy-1,4-benzoquinol}} | + | {{#set: inchi key=InChIKey=WEGXYVFDOLUULO-TUUMQRACSA-N}} |
| + | {{#set: common name=2-methoxy-6-all trans-heptaprenyl-1,4-benzoquinol}} | ||
| + | {{#set: common name=2-methoxy-6-heptaprenyl-1,4-benzoquinol}} | ||
{{#set: consumed by=RXN-9227}} | {{#set: consumed by=RXN-9227}} | ||
Latest revision as of 13:38, 10 January 2019
Contents
Metabolite CPD-9858
- smiles:
- CC(C)=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(C(=C(OC)C=C(C=1)O)O))C)C)C)C)C)C
- molecular weight:
- 616.966
- inchi key:
- InChIKey=WEGXYVFDOLUULO-TUUMQRACSA-N
- common name:
- 2-methoxy-6-all trans-heptaprenyl-1,4-benzoquinol
- Synonym(s):
- 2-methoxy-6-heptaprenyl-1,4-benzoquinol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
