Difference between revisions of "CPD-17312"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17312 CPD-17312] == * smiles: ** CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] | ** CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 1073.981 | ** 1073.981 | ||
| + | * inchi key: | ||
| + | ** InChIKey=MENFZXMQSYYVRK-CRCGJGBYSA-J | ||
| + | * common name: | ||
| + | ** docosahexaenoyl-CoA | ||
* Synonym(s): | * Synonym(s): | ||
** all-cis-docosa-4,7,10,13,16,19-hexaenoyl-CoA | ** all-cis-docosa-4,7,10,13,16,19-hexaenoyl-CoA | ||
| Line 19: | Line 19: | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
* [[RXN-16063]] | * [[RXN-16063]] | ||
| − | |||
== External links == | == External links == | ||
| − | |||
| − | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=74298 74298] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=74298 74298] | ||
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=71581248 71581248] | ||
| + | * REFMET : Docosahexaenoyl-CoA | ||
{{#set: smiles=CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} | {{#set: smiles=CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} | ||
| − | |||
| − | |||
{{#set: molecular weight=1073.981 }} | {{#set: molecular weight=1073.981 }} | ||
| + | {{#set: inchi key=InChIKey=MENFZXMQSYYVRK-CRCGJGBYSA-J}} | ||
| + | {{#set: common name=docosahexaenoyl-CoA}} | ||
{{#set: common name=all-cis-docosa-4,7,10,13,16,19-hexaenoyl-CoA|(4Z,7Z,10Z,13Z,16Z,19Z)-docosahexaenoyl-CoA|(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl-CoA}} | {{#set: common name=all-cis-docosa-4,7,10,13,16,19-hexaenoyl-CoA|(4Z,7Z,10Z,13Z,16Z,19Z)-docosahexaenoyl-CoA|(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl-CoA}} | ||
{{#set: produced by=RXN-16137}} | {{#set: produced by=RXN-16137}} | ||
| − | {{#set: reversible reaction associated=RXN-16063 | + | {{#set: reversible reaction associated=RXN-16063}} |
Latest revision as of 13:42, 10 January 2019
Contents
Metabolite CPD-17312
- smiles:
- CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- molecular weight:
- 1073.981
- inchi key:
- InChIKey=MENFZXMQSYYVRK-CRCGJGBYSA-J
- common name:
- docosahexaenoyl-CoA
- Synonym(s):
- all-cis-docosa-4,7,10,13,16,19-hexaenoyl-CoA
- (4Z,7Z,10Z,13Z,16Z,19Z)-docosahexaenoyl-CoA
- (4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.
