Difference between revisions of "CPD-5821"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-5821 CPD-5821] == * smiles: ** C(C1(O)(NC(=O)N=C1NC(N)=O))(=O)[O-] * common name: ** 2-oxo-...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C(C1(O)(NC(=O)N=C1NC(N)=O))(=O)[O-] | ** C(C1(O)(NC(=O)N=C1NC(N)=O))(=O)[O-] | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 201.118 | ** 201.118 | ||
| + | * inchi key: | ||
| + | ** InChIKey=WHKYNCPIXMNTRQ-YFKPBYRVSA-M | ||
| + | * common name: | ||
| + | ** (S)-2-oxo-4-hydroxy-4-carboxy-5-ureidoimidazoline | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** 5-hydroxy-2-oxo-4-ureido-2,5-dihydro-1H imidazole-5-carboxylate | + | ** (S)-5-hydroxy-2-oxo-4-ureido-2,5-dihydro-1H imidazole-5-carboxylate |
| − | ** OHCU | + | ** (S)-OHCU |
| + | ** 4-(carbamoylamino)-5-hydroxy-2-oxo-2,5-dihydro-1H-imidazole-5-carboxylate | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| Line 19: | Line 20: | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58639 58639] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58639 58639] | ||
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=101957721 101957721] | ||
| + | * HMDB : HMDB59663 | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
** [http://www.genome.jp/dbget-bin/www_bget?C12248 C12248] | ** [http://www.genome.jp/dbget-bin/www_bget?C12248 C12248] | ||
| + | * CHEMSPIDER: | ||
| + | ** [http://www.chemspider.com/Chemical-Structure.20016217.html 20016217] | ||
{{#set: smiles=C(C1(O)(NC(=O)N=C1NC(N)=O))(=O)[O-]}} | {{#set: smiles=C(C1(O)(NC(=O)N=C1NC(N)=O))(=O)[O-]}} | ||
| − | |||
| − | |||
{{#set: molecular weight=201.118 }} | {{#set: molecular weight=201.118 }} | ||
| − | {{#set: common name=5-hydroxy-2-oxo-4-ureido-2,5-dihydro-1H imidazole-5-carboxylate|OHCU}} | + | {{#set: inchi key=InChIKey=WHKYNCPIXMNTRQ-YFKPBYRVSA-M}} |
| + | {{#set: common name=(S)-2-oxo-4-hydroxy-4-carboxy-5-ureidoimidazoline}} | ||
| + | {{#set: common name=(S)-5-hydroxy-2-oxo-4-ureido-2,5-dihydro-1H imidazole-5-carboxylate|(S)-OHCU|4-(carbamoylamino)-5-hydroxy-2-oxo-2,5-dihydro-1H-imidazole-5-carboxylate}} | ||
{{#set: consumed by=RXN-6201}} | {{#set: consumed by=RXN-6201}} | ||
{{#set: produced by=3.5.2.17-RXN}} | {{#set: produced by=3.5.2.17-RXN}} | ||
Latest revision as of 13:46, 10 January 2019
Contents
Metabolite CPD-5821
- smiles:
- C(C1(O)(NC(=O)N=C1NC(N)=O))(=O)[O-]
- molecular weight:
- 201.118
- inchi key:
- InChIKey=WHKYNCPIXMNTRQ-YFKPBYRVSA-M
- common name:
- (S)-2-oxo-4-hydroxy-4-carboxy-5-ureidoimidazoline
- Synonym(s):
- (S)-5-hydroxy-2-oxo-4-ureido-2,5-dihydro-1H imidazole-5-carboxylate
- (S)-OHCU
- 4-(carbamoylamino)-5-hydroxy-2-oxo-2,5-dihydro-1H-imidazole-5-carboxylate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(C1(O)(NC(=O)N=C1NC(N)=O))(=O)[O-" cannot be used as a page name in this wiki.
