Difference between revisions of "CPD-7066"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7066 CPD-7066] == * smiles: ** CC(C(=O)[O-])C(O)C([O-])=O * common name: ** (2R,3S)-3-methy...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** CC(C(=O)[O-])C(O)C([O-])=O | ** CC(C(=O)[O-])C(O)C([O-])=O | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 146.099 | ** 146.099 | ||
| + | * inchi key: | ||
| + | ** InChIKey=NPYQJIHHTGFBLN-STHAYSLISA-L | ||
| + | * common name: | ||
| + | ** (2R,3S)-3-methylmalate | ||
* Synonym(s): | * Synonym(s): | ||
** D-erythro-3-methylmalate | ** D-erythro-3-methylmalate | ||
| Line 20: | Line 20: | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | |||
| − | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58511 58511] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58511 58511] | ||
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266666 45266666] | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
** [http://www.genome.jp/dbget-bin/www_bget?C06029 C06029] | ** [http://www.genome.jp/dbget-bin/www_bget?C06029 C06029] | ||
{{#set: smiles=CC(C(=O)[O-])C(O)C([O-])=O}} | {{#set: smiles=CC(C(=O)[O-])C(O)C([O-])=O}} | ||
| − | |||
| − | |||
{{#set: molecular weight=146.099 }} | {{#set: molecular weight=146.099 }} | ||
| + | {{#set: inchi key=InChIKey=NPYQJIHHTGFBLN-STHAYSLISA-L}} | ||
| + | {{#set: common name=(2R,3S)-3-methylmalate}} | ||
{{#set: common name=D-erythro-3-methylmalate|erythro-β-methyl-D-malate|β-erythro-methylmalate|β-methyl-D-malate}} | {{#set: common name=D-erythro-3-methylmalate|erythro-β-methyl-D-malate|β-erythro-methylmalate|β-methyl-D-malate}} | ||
{{#set: consumed by=RXN-7745}} | {{#set: consumed by=RXN-7745}} | ||
Latest revision as of 13:51, 10 January 2019
Contents
Metabolite CPD-7066
- smiles:
- CC(C(=O)[O-])C(O)C([O-])=O
- molecular weight:
- 146.099
- inchi key:
- InChIKey=NPYQJIHHTGFBLN-STHAYSLISA-L
- common name:
- (2R,3S)-3-methylmalate
- Synonym(s):
- D-erythro-3-methylmalate
- erythro-β-methyl-D-malate
- β-erythro-methylmalate
- β-methyl-D-malate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C(=O)[O-])C(O)C([O-])=O" cannot be used as a page name in this wiki.
