Difference between revisions of "CPD-15431"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15431 CPD-15431] == * smiles: ** CC(C)=CCCC(C)=CCCC(C)=CCCC(=CCCC(=CCCC(=CCCC(C)=CCCC(=CCCC...") |
|||
Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** CC(C)=CCCC(C)=CCCC(C)=CCCC(=CCCC(=CCCC(=CCCC(C)=CCCC(=CCCC(=CCCC(=CCCC(=CCOP(=O)([O-])OP([O-])(=O)OC1(C(C(C(C(O1)CO)O)OC2(OC(CO)C(O)C(O)C(NC(=O)C)2))NC(C)=O))C)C)C)C)C)C)C | ** CC(C)=CCCC(C)=CCCC(C)=CCCC(=CCCC(=CCCC(=CCCC(C)=CCCC(=CCCC(=CCCC(=CCCC(=CCOP(=O)([O-])OP([O-])(=O)OC1(C(C(C(C(O1)CO)O)OC2(OC(CO)C(O)C(O)C(NC(=O)C)2))NC(C)=O))C)C)C)C)C)C)C | ||
− | |||
− | |||
− | |||
− | |||
* molecular weight: | * molecular weight: | ||
** 1331.648 | ** 1331.648 | ||
+ | * inchi key: | ||
+ | ** InChIKey=SGCLPRBYAHBRPD-QOZJJACASA-L | ||
+ | * common name: | ||
+ | ** N-acetyl-α-D-galactosaminyl-(1→3)-N-acetyl-α-D-galactosaminyldiphospho-ditrans,octacis-undecaprenol | ||
* Synonym(s): | * Synonym(s): | ||
** α-D-GalNAc-(1→3)-α-D-GalNAc-diphospho-ditrans,octacis-undecaprenol | ** α-D-GalNAc-(1→3)-α-D-GalNAc-diphospho-ditrans,octacis-undecaprenol | ||
Line 17: | Line 17: | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | |||
− | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=73987 73987] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=73987 73987] | ||
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=71581108 71581108] | ||
{{#set: smiles=CC(C)=CCCC(C)=CCCC(C)=CCCC(=CCCC(=CCCC(=CCCC(C)=CCCC(=CCCC(=CCCC(=CCCC(=CCOP(=O)([O-])OP([O-])(=O)OC1(C(C(C(C(O1)CO)O)OC2(OC(CO)C(O)C(O)C(NC(=O)C)2))NC(C)=O))C)C)C)C)C)C)C}} | {{#set: smiles=CC(C)=CCCC(C)=CCCC(C)=CCCC(=CCCC(=CCCC(=CCCC(C)=CCCC(=CCCC(=CCCC(=CCCC(=CCOP(=O)([O-])OP([O-])(=O)OC1(C(C(C(C(O1)CO)O)OC2(OC(CO)C(O)C(O)C(NC(=O)C)2))NC(C)=O))C)C)C)C)C)C)C}} | ||
− | |||
− | |||
{{#set: molecular weight=1331.648 }} | {{#set: molecular weight=1331.648 }} | ||
+ | {{#set: inchi key=InChIKey=SGCLPRBYAHBRPD-QOZJJACASA-L}} | ||
+ | {{#set: common name=N-acetyl-α-D-galactosaminyl-(1→3)-N-acetyl-α-D-galactosaminyldiphospho-ditrans,octacis-undecaprenol}} | ||
{{#set: common name=α-D-GalNAc-(1→3)-α-D-GalNAc-diphospho-ditrans,octacis-undecaprenol}} | {{#set: common name=α-D-GalNAc-(1→3)-α-D-GalNAc-diphospho-ditrans,octacis-undecaprenol}} | ||
{{#set: consumed by=RXN-14561}} | {{#set: consumed by=RXN-14561}} |
Latest revision as of 14:01, 10 January 2019
Contents
Metabolite CPD-15431
- smiles:
- CC(C)=CCCC(C)=CCCC(C)=CCCC(=CCCC(=CCCC(=CCCC(C)=CCCC(=CCCC(=CCCC(=CCCC(=CCOP(=O)([O-])OP([O-])(=O)OC1(C(C(C(C(O1)CO)O)OC2(OC(CO)C(O)C(O)C(NC(=O)C)2))NC(C)=O))C)C)C)C)C)C)C
- molecular weight:
- 1331.648
- inchi key:
- InChIKey=SGCLPRBYAHBRPD-QOZJJACASA-L
- common name:
- N-acetyl-α-D-galactosaminyl-(1→3)-N-acetyl-α-D-galactosaminyldiphospho-ditrans,octacis-undecaprenol
- Synonym(s):
- α-D-GalNAc-(1→3)-α-D-GalNAc-diphospho-ditrans,octacis-undecaprenol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)=CCCC(C)=CCCC(C)=CCCC(=CCCC(=CCCC(=CCCC(C)=CCCC(=CCCC(=CCCC(=CCCC(=CCOP(=O)([O-])OP([O-])(=O)OC1(C(C(C(C(O1)CO)O)OC2(OC(CO)C(O)C(O)C(NC(=O)C)2))NC(C)=O))C)C)C)C)C)C)C" cannot be used as a page name in this wiki.