Difference between revisions of "CPD-316"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-316 CPD-316] == * smiles: ** CC1(=C(C=C2(C(=C1)NC3(C(N2CC(O)C(O)C(O)CO)=NC(NC3=O)=O)))C) *...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** CC1(=C(C=C2(C(=C1)NC3(C(N2CC(O)C(O)C(O)CO)=NC(NC3=O)=O)))C) | ** CC1(=C(C=C2(C(=C1)NC3(C(N2CC(O)C(O)C(O)CO)=NC(NC3=O)=O)))C) | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 378.384 | ** 378.384 | ||
| + | * inchi key: | ||
| + | ** InChIKey=UTKDOUCGQVLJIN-PIGZVRMJSA-N | ||
| + | * common name: | ||
| + | ** reduced riboflavin | ||
* Synonym(s): | * Synonym(s): | ||
** 4a,5-dihydroriboflavine | ** 4a,5-dihydroriboflavine | ||
| Line 20: | Line 20: | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| + | * CHEMSPIDER: | ||
| + | ** [http://www.chemspider.com/Chemical-Structure.52885.html 52885] | ||
* PUBCHEM: | * PUBCHEM: | ||
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45480537 45480537] | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45480537 45480537] | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=8798 8798] | ||
* HMDB : HMDB01557 | * HMDB : HMDB01557 | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
** [http://www.genome.jp/dbget-bin/www_bget?C01007 C01007] | ** [http://www.genome.jp/dbget-bin/www_bget?C01007 C01007] | ||
| − | |||
| − | |||
| − | |||
| − | |||
* BIGG : rbflvrd | * BIGG : rbflvrd | ||
{{#set: smiles=CC1(=C(C=C2(C(=C1)NC3(C(N2CC(O)C(O)C(O)CO)=NC(NC3=O)=O)))C)}} | {{#set: smiles=CC1(=C(C=C2(C(=C1)NC3(C(N2CC(O)C(O)C(O)CO)=NC(NC3=O)=O)))C)}} | ||
| − | |||
| − | |||
{{#set: molecular weight=378.384 }} | {{#set: molecular weight=378.384 }} | ||
| + | {{#set: inchi key=InChIKey=UTKDOUCGQVLJIN-PIGZVRMJSA-N}} | ||
| + | {{#set: common name=reduced riboflavin}} | ||
{{#set: common name=4a,5-dihydroriboflavine|7,8-dimethyl-10-(D-ribo-2,3,4,5-tetrahydroxypentyl)-4a,5-dihydroisoalloxazine|7,8-dimethyl-10-(D-ribo-2,3,4,5-tetrahydroxypentyl)-5,10-dihydrobenzo[g]pteridine-2,4(3H,4aH)-dione}} | {{#set: common name=4a,5-dihydroriboflavine|7,8-dimethyl-10-(D-ribo-2,3,4,5-tetrahydroxypentyl)-4a,5-dihydroisoalloxazine|7,8-dimethyl-10-(D-ribo-2,3,4,5-tetrahydroxypentyl)-5,10-dihydrobenzo[g]pteridine-2,4(3H,4aH)-dione}} | ||
{{#set: produced by=RXN-12445|NADPH-DEHYDROGENASE-FLAVIN-RXN}} | {{#set: produced by=RXN-12445|NADPH-DEHYDROGENASE-FLAVIN-RXN}} | ||
Latest revision as of 14:07, 10 January 2019
Contents
Metabolite CPD-316
- smiles:
- CC1(=C(C=C2(C(=C1)NC3(C(N2CC(O)C(O)C(O)CO)=NC(NC3=O)=O)))C)
- molecular weight:
- 378.384
- inchi key:
- InChIKey=UTKDOUCGQVLJIN-PIGZVRMJSA-N
- common name:
- reduced riboflavin
- Synonym(s):
- 4a,5-dihydroriboflavine
- 7,8-dimethyl-10-(D-ribo-2,3,4,5-tetrahydroxypentyl)-4a,5-dihydroisoalloxazine
- 7,8-dimethyl-10-(D-ribo-2,3,4,5-tetrahydroxypentyl)-5,10-dihydrobenzo[g]pteridine-2,4(3H,4aH)-dione
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"7,8-dimethyl-10-(D-ribo-2,3,4,5-tetrahydroxypentyl)-5,10-dihydrobenzo[g]pteridine-2,4(3H,4aH)-dione" cannot be used as a page name in this wiki.
