Difference between revisions of "CPD-14152"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14152 CPD-14152] == * smiles: ** C1(=CC(=N)C(C=C1)=O) * common name: ** 1,2-benzoquinone mo...") |
|||
Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C1(=CC(=N)C(C=C1)=O) | ** C1(=CC(=N)C(C=C1)=O) | ||
− | |||
− | |||
− | |||
− | |||
* molecular weight: | * molecular weight: | ||
** 107.112 | ** 107.112 | ||
+ | * inchi key: | ||
+ | ** InChIKey=PEARLFKWERPXDA-UHFFFAOYSA-N | ||
+ | * common name: | ||
+ | ** 1,2-benzoquinone monoimine | ||
* Synonym(s): | * Synonym(s): | ||
** 6-iminocyclohexa-2,4-dien-1-one | ** 6-iminocyclohexa-2,4-dien-1-one | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
* [[RXN-13159]] | * [[RXN-13159]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | |||
− | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=55409 55409] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=55409 55409] | ||
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=15903259 15903259] | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
** [http://www.genome.jp/dbget-bin/www_bget?C17500 C17500] | ** [http://www.genome.jp/dbget-bin/www_bget?C17500 C17500] | ||
{{#set: smiles=C1(=CC(=N)C(C=C1)=O)}} | {{#set: smiles=C1(=CC(=N)C(C=C1)=O)}} | ||
− | |||
− | |||
{{#set: molecular weight=107.112 }} | {{#set: molecular weight=107.112 }} | ||
+ | {{#set: inchi key=InChIKey=PEARLFKWERPXDA-UHFFFAOYSA-N}} | ||
+ | {{#set: common name=1,2-benzoquinone monoimine}} | ||
{{#set: common name=6-iminocyclohexa-2,4-dien-1-one}} | {{#set: common name=6-iminocyclohexa-2,4-dien-1-one}} | ||
− | |||
{{#set: produced by=RXN-13159}} | {{#set: produced by=RXN-13159}} |
Latest revision as of 14:20, 10 January 2019
Contents
Metabolite CPD-14152
- smiles:
- C1(=CC(=N)C(C=C1)=O)
- molecular weight:
- 107.112
- inchi key:
- InChIKey=PEARLFKWERPXDA-UHFFFAOYSA-N
- common name:
- 1,2-benzoquinone monoimine
- Synonym(s):
- 6-iminocyclohexa-2,4-dien-1-one
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links