Difference between revisions of "CPD-10809"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10809 CPD-10809] == * smiles: ** C(NC1(N=C(NC(=O)C(N)=1)N))C(O)C(O)C(O)COP([O-])(=O)[O-] *...") |
|||
Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C(NC1(N=C(NC(=O)C(N)=1)N))C(O)C(O)C(O)COP([O-])(=O)[O-] | ** C(NC1(N=C(NC(=O)C(N)=1)N))C(O)C(O)C(O)COP([O-])(=O)[O-] | ||
− | |||
− | |||
− | |||
− | |||
* molecular weight: | * molecular weight: | ||
** 353.228 | ** 353.228 | ||
+ | * inchi key: | ||
+ | ** InChIKey=ACIVVGBVOVHFPQ-RPDRRWSUSA-L | ||
+ | * common name: | ||
+ | ** 2,5-diamino-6-(5-phospho-D-ribitylamino)pyrimidin-4(3H)-one | ||
* Synonym(s): | * Synonym(s): | ||
** 2,5-diamino-6-ribitylamino-4(3H)-pyrimidinone 5'-phosphate | ** 2,5-diamino-6-ribitylamino-4(3H)-pyrimidinone 5'-phosphate | ||
Line 18: | Line 18: | ||
* [[RXN-14171]] | * [[RXN-14171]] | ||
== External links == | == External links == | ||
− | |||
− | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58890 58890] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58890 58890] | ||
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45480553 45480553] | ||
{{#set: smiles=C(NC1(N=C(NC(=O)C(N)=1)N))C(O)C(O)C(O)COP([O-])(=O)[O-]}} | {{#set: smiles=C(NC1(N=C(NC(=O)C(N)=1)N))C(O)C(O)C(O)COP([O-])(=O)[O-]}} | ||
− | |||
− | |||
{{#set: molecular weight=353.228 }} | {{#set: molecular weight=353.228 }} | ||
+ | {{#set: inchi key=InChIKey=ACIVVGBVOVHFPQ-RPDRRWSUSA-L}} | ||
+ | {{#set: common name=2,5-diamino-6-(5-phospho-D-ribitylamino)pyrimidin-4(3H)-one}} | ||
{{#set: common name=2,5-diamino-6-ribitylamino-4(3H)-pyrimidinone 5'-phosphate}} | {{#set: common name=2,5-diamino-6-ribitylamino-4(3H)-pyrimidinone 5'-phosphate}} | ||
{{#set: produced by=RXN-10057}} | {{#set: produced by=RXN-10057}} | ||
{{#set: reversible reaction associated=RXN-14171}} | {{#set: reversible reaction associated=RXN-14171}} |
Latest revision as of 15:25, 10 January 2019
Contents
Metabolite CPD-10809
- smiles:
- C(NC1(N=C(NC(=O)C(N)=1)N))C(O)C(O)C(O)COP([O-])(=O)[O-]
- molecular weight:
- 353.228
- inchi key:
- InChIKey=ACIVVGBVOVHFPQ-RPDRRWSUSA-L
- common name:
- 2,5-diamino-6-(5-phospho-D-ribitylamino)pyrimidin-4(3H)-one
- Synonym(s):
- 2,5-diamino-6-ribitylamino-4(3H)-pyrimidinone 5'-phosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(NC1(N=C(NC(=O)C(N)=1)N))C(O)C(O)C(O)COP([O-])(=O)[O-" cannot be used as a page name in this wiki.