Difference between revisions of "MANNOSE-1P"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MANNOSE-1P MANNOSE-1P] == * smiles: ** C(O)C1(OC(OP(=O)([O-])[O-])C(O)C(O)C(O)1) * common name:...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C(O)C1(OC(OP(=O)([O-])[O-])C(O)C(O)C(O)1) | ** C(O)C1(OC(OP(=O)([O-])[O-])C(O)C(O)C(O)1) | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 258.121 | ** 258.121 | ||
| + | * inchi key: | ||
| + | ** InChIKey=HXXFSFRBOHSIMQ-RWOPYEJCSA-L | ||
| + | * common name: | ||
| + | ** α-D-mannose 1-phosphate | ||
* Synonym(s): | * Synonym(s): | ||
** mannose-1-phosphate | ** mannose-1-phosphate | ||
| Line 17: | Line 17: | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
* [[RXN4FS-12]] | * [[RXN4FS-12]] | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | |||
* [[MANNPGUANYLTRANGDP-RXN]] | * [[MANNPGUANYLTRANGDP-RXN]] | ||
| + | * [[PHOSMANMUT-RXN-MANNOSE-1P//MANNOSE-6P.23.]] | ||
* [[PHOSMANMUT-RXN]] | * [[PHOSMANMUT-RXN]] | ||
== External links == | == External links == | ||
| − | |||
* PUBCHEM: | * PUBCHEM: | ||
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245607 25245607] | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245607 25245607] | ||
| − | |||
| − | |||
| − | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58409 58409] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58409 58409] | ||
| + | * CAS : 27251-84-9 | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C00636 C00636] | ||
| + | * HMDB : HMDB06330 | ||
* BIGG : man1p | * BIGG : man1p | ||
{{#set: smiles=C(O)C1(OC(OP(=O)([O-])[O-])C(O)C(O)C(O)1)}} | {{#set: smiles=C(O)C1(OC(OP(=O)([O-])[O-])C(O)C(O)C(O)1)}} | ||
| − | |||
| − | |||
{{#set: molecular weight=258.121 }} | {{#set: molecular weight=258.121 }} | ||
| + | {{#set: inchi key=InChIKey=HXXFSFRBOHSIMQ-RWOPYEJCSA-L}} | ||
| + | {{#set: common name=α-D-mannose 1-phosphate}} | ||
{{#set: common name=mannose-1-phosphate|D-mannose-1-phosphate|mannose-1-P|α-D-mannopyranose 1-phosphate}} | {{#set: common name=mannose-1-phosphate|D-mannose-1-phosphate|mannose-1-P|α-D-mannopyranose 1-phosphate}} | ||
| − | {{#set: consumed by=RXN4FS-12 | + | {{#set: consumed by=RXN4FS-12}} |
| − | {{#set: reversible reaction associated=PHOSMANMUT-RXN-MANNOSE-1P//MANNOSE-6P.23. | + | {{#set: reversible reaction associated=MANNPGUANYLTRANGDP-RXN|PHOSMANMUT-RXN-MANNOSE-1P//MANNOSE-6P.23.|PHOSMANMUT-RXN}} |
Latest revision as of 15:25, 10 January 2019
Contents
Metabolite MANNOSE-1P
- smiles:
- C(O)C1(OC(OP(=O)([O-])[O-])C(O)C(O)C(O)1)
- molecular weight:
- 258.121
- inchi key:
- InChIKey=HXXFSFRBOHSIMQ-RWOPYEJCSA-L
- common name:
- α-D-mannose 1-phosphate
- Synonym(s):
- mannose-1-phosphate
- D-mannose-1-phosphate
- mannose-1-P
- α-D-mannopyranose 1-phosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(O)C1(OC(OP(=O)([O-])[O-])C(O)C(O)C(O)1)" cannot be used as a page name in this wiki.
