Difference between revisions of "3-KETOLACTOSE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-KETOLACTOSE 3-KETOLACTOSE] == * smiles: ** C(O)C2(OC(OC1(C(CO)OC(O)C(O)C(O)1))C(O)C(=O)C(O)2)...") |
|||
Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C(O)C2(OC(OC1(C(CO)OC(O)C(O)C(O)1))C(O)C(=O)C(O)2) | ** C(O)C2(OC(OC1(C(CO)OC(O)C(O)C(O)1))C(O)C(=O)C(O)2) | ||
− | |||
− | |||
− | |||
− | |||
* molecular weight: | * molecular weight: | ||
** 340.283 | ** 340.283 | ||
+ | * inchi key: | ||
+ | ** InChIKey=HKKHTABTHSUDBP-GIHCHDTPSA-N | ||
+ | * common name: | ||
+ | ** 3'-ketolactose | ||
* Synonym(s): | * Synonym(s): | ||
** 3'-dehydro-β-D-galactosyl-β-D-glucopyranoside | ** 3'-dehydro-β-D-galactosyl-β-D-glucopyranoside | ||
Line 17: | Line 17: | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | |||
− | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=27571 27571] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=27571 27571] | ||
* PUBCHEM: | * PUBCHEM: | ||
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25201057 25201057] | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25201057 25201057] | ||
+ | * HMDB : HMDB01030 | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
** [http://www.genome.jp/dbget-bin/www_bget?C05403 C05403] | ** [http://www.genome.jp/dbget-bin/www_bget?C05403 C05403] | ||
+ | * KEGG-GLYCAN : G10531 | ||
{{#set: smiles=C(O)C2(OC(OC1(C(CO)OC(O)C(O)C(O)1))C(O)C(=O)C(O)2)}} | {{#set: smiles=C(O)C2(OC(OC1(C(CO)OC(O)C(O)C(O)1))C(O)C(=O)C(O)2)}} | ||
− | |||
− | |||
{{#set: molecular weight=340.283 }} | {{#set: molecular weight=340.283 }} | ||
+ | {{#set: inchi key=InChIKey=HKKHTABTHSUDBP-GIHCHDTPSA-N}} | ||
+ | {{#set: common name=3'-ketolactose}} | ||
{{#set: common name=3'-dehydro-β-D-galactosyl-β-D-glucopyranoside}} | {{#set: common name=3'-dehydro-β-D-galactosyl-β-D-glucopyranoside}} | ||
{{#set: consumed by=KETOLACTOSE-RXN}} | {{#set: consumed by=KETOLACTOSE-RXN}} |
Latest revision as of 15:26, 10 January 2019
Contents
Metabolite 3-KETOLACTOSE
- smiles:
- C(O)C2(OC(OC1(C(CO)OC(O)C(O)C(O)1))C(O)C(=O)C(O)2)
- molecular weight:
- 340.283
- inchi key:
- InChIKey=HKKHTABTHSUDBP-GIHCHDTPSA-N
- common name:
- 3'-ketolactose
- Synonym(s):
- 3'-dehydro-β-D-galactosyl-β-D-glucopyranoside
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links