Difference between revisions of "CPD-14154"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14154 CPD-14154] == * smiles: ** C([N+])C1(C(CC(C(O1)OC2(C(C(C([N+])CC([N+])2)OC3(OC(C(C(C(...") |
|||
Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C([N+])C1(C(CC(C(O1)OC2(C(C(C([N+])CC([N+])2)OC3(OC(C(C(C(O)3)[N+])O)CO))O))[N+])O) | ** C([N+])C1(C(CC(C(O1)OC2(C(C(C([N+])CC([N+])2)OC3(OC(C(C(C(O)3)[N+])O)CO))O))[N+])O) | ||
− | |||
− | |||
− | |||
− | |||
* molecular weight: | * molecular weight: | ||
** 472.558 | ** 472.558 | ||
+ | * inchi key: | ||
+ | ** InChIKey=NLVFBUXFDBBNBW-PBSUHMDJSA-S | ||
+ | * common name: | ||
+ | ** tobramycin | ||
* Synonym(s): | * Synonym(s): | ||
Line 17: | Line 17: | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | |||
− | |||
− | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=73678 73678] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=73678 73678] | ||
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=51432351 51432351] | ||
* HMDB : HMDB14822 | * HMDB : HMDB14822 | ||
+ | * REFMET : Tobramycin | ||
+ | * DRUGBANK : DB00684 | ||
{{#set: smiles=C([N+])C1(C(CC(C(O1)OC2(C(C(C([N+])CC([N+])2)OC3(OC(C(C(C(O)3)[N+])O)CO))O))[N+])O)}} | {{#set: smiles=C([N+])C1(C(CC(C(O1)OC2(C(C(C([N+])CC([N+])2)OC3(OC(C(C(C(O)3)[N+])O)CO))O))[N+])O)}} | ||
− | |||
− | |||
{{#set: molecular weight=472.558 }} | {{#set: molecular weight=472.558 }} | ||
+ | {{#set: inchi key=InChIKey=NLVFBUXFDBBNBW-PBSUHMDJSA-S}} | ||
+ | {{#set: common name=tobramycin}} | ||
{{#set: consumed by=RXN-13168|RXN-15284}} | {{#set: consumed by=RXN-13168|RXN-15284}} |
Latest revision as of 14:28, 10 January 2019
Contents
Metabolite CPD-14154
- smiles:
- C([N+])C1(C(CC(C(O1)OC2(C(C(C([N+])CC([N+])2)OC3(OC(C(C(C(O)3)[N+])O)CO))O))[N+])O)
- molecular weight:
- 472.558
- inchi key:
- InChIKey=NLVFBUXFDBBNBW-PBSUHMDJSA-S
- common name:
- tobramycin
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C([N+])C1(C(CC(C(O1)OC2(C(C(C([N+])CC([N+])2)OC3(OC(C(C(C(O)3)[N+])O)CO))O))[N+])O)" cannot be used as a page name in this wiki.