Difference between revisions of "PROSTAGLANDIN-H2"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PROSTAGLANDIN-H2 PROSTAGLANDIN-H2] == * smiles: ** CCCCCC(O)C=CC2(C1(CC(OO1)C(CC=CCCCC(=O)[O-])...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** CCCCCC(O)C=CC2(C1(CC(OO1)C(CC=CCCCC(=O)[O-])2)) | ** CCCCCC(O)C=CC2(C1(CC(OO1)C(CC=CCCCC(=O)[O-])2)) | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 351.462 | ** 351.462 | ||
| + | * inchi key: | ||
| + | ** InChIKey=YIBNHAJFJUQSRA-YNNPMVKQSA-M | ||
| + | * common name: | ||
| + | ** prostaglandin-H2 | ||
* Synonym(s): | * Synonym(s): | ||
** (5Z, 13E)-(15S)-9α,11α-epidioxy-15-hydroxyprosta-5,13-dienoate | ** (5Z, 13E)-(15S)-9α,11α-epidioxy-15-hydroxyprosta-5,13-dienoate | ||
| Line 15: | Line 15: | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
* [[PROSTAGLANDIN-D-SYNTHASE-RXN]] | * [[PROSTAGLANDIN-D-SYNTHASE-RXN]] | ||
| + | * [[PROSTAGLANDIN-E-SYNTHASE-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | |||
| − | |||
| − | |||
| − | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=15554 15554] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=15554 15554] | ||
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245222 25245222] | ||
| + | * CAS : 42935-17-1 | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
** [http://www.genome.jp/dbget-bin/www_bget?C00427 C00427] | ** [http://www.genome.jp/dbget-bin/www_bget?C00427 C00427] | ||
| + | * HMDB : HMDB01381 | ||
{{#set: smiles=CCCCCC(O)C=CC2(C1(CC(OO1)C(CC=CCCCC(=O)[O-])2))}} | {{#set: smiles=CCCCCC(O)C=CC2(C1(CC(OO1)C(CC=CCCCC(=O)[O-])2))}} | ||
| − | |||
| − | |||
{{#set: molecular weight=351.462 }} | {{#set: molecular weight=351.462 }} | ||
| + | {{#set: inchi key=InChIKey=YIBNHAJFJUQSRA-YNNPMVKQSA-M}} | ||
| + | {{#set: common name=prostaglandin-H2}} | ||
{{#set: common name=(5Z, 13E)-(15S)-9α,11α-epidioxy-15-hydroxyprosta-5,13-dienoate|(5Z,13E)-(15S)-9α,11α-epidioxy-15-hydroxyprosta-5,13-dienoate|(5Z,9α,11α,13E,15S)-9,11-epidioxy-15-hydroxy-prosta-5,13-dienoate}} | {{#set: common name=(5Z, 13E)-(15S)-9α,11α-epidioxy-15-hydroxyprosta-5,13-dienoate|(5Z,13E)-(15S)-9α,11α-epidioxy-15-hydroxyprosta-5,13-dienoate|(5Z,9α,11α,13E,15S)-9,11-epidioxy-15-hydroxy-prosta-5,13-dienoate}} | ||
| − | {{#set: consumed by=PROSTAGLANDIN- | + | {{#set: consumed by=PROSTAGLANDIN-D-SYNTHASE-RXN|PROSTAGLANDIN-E-SYNTHASE-RXN}} |
Latest revision as of 15:28, 10 January 2019
Contents
Metabolite PROSTAGLANDIN-H2
- smiles:
- CCCCCC(O)C=CC2(C1(CC(OO1)C(CC=CCCCC(=O)[O-])2))
- molecular weight:
- 351.462
- inchi key:
- InChIKey=YIBNHAJFJUQSRA-YNNPMVKQSA-M
- common name:
- prostaglandin-H2
- Synonym(s):
- (5Z, 13E)-(15S)-9α,11α-epidioxy-15-hydroxyprosta-5,13-dienoate
- (5Z,13E)-(15S)-9α,11α-epidioxy-15-hydroxyprosta-5,13-dienoate
- (5Z,9α,11α,13E,15S)-9,11-epidioxy-15-hydroxy-prosta-5,13-dienoate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCCCCC(O)C=CC2(C1(CC(OO1)C(CC=CCCCC(=O)[O-])2))" cannot be used as a page name in this wiki.
