Difference between revisions of "CPD-7025"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7025 CPD-7025] == * smiles: ** CC(CCCC(CCCC(C)CCCC(C)=CCOP([O-])(=O)[O-])C)C * common name:...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** CC(CCCC(CCCC(C)CCCC(C)=CCOP([O-])(=O)[O-])C)C | ** CC(CCCC(CCCC(C)CCCC(C)=CCOP([O-])(=O)[O-])C)C | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 374.499 | ** 374.499 | ||
| + | * inchi key: | ||
| + | ** InChIKey=YRXRHZOKDFCXIB-PYDDKJGSSA-L | ||
| + | * common name: | ||
| + | ** phytyl monophosphate | ||
* Synonym(s): | * Synonym(s): | ||
** phytolmonophosphate | ** phytolmonophosphate | ||
| Line 17: | Line 17: | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | |||
| − | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=75483 75483] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=75483 75483] | ||
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245113 25245113] | ||
{{#set: smiles=CC(CCCC(CCCC(C)CCCC(C)=CCOP([O-])(=O)[O-])C)C}} | {{#set: smiles=CC(CCCC(CCCC(C)CCCC(C)=CCOP([O-])(=O)[O-])C)C}} | ||
| − | |||
| − | |||
{{#set: molecular weight=374.499 }} | {{#set: molecular weight=374.499 }} | ||
| + | {{#set: inchi key=InChIKey=YRXRHZOKDFCXIB-PYDDKJGSSA-L}} | ||
| + | {{#set: common name=phytyl monophosphate}} | ||
{{#set: common name=phytolmonophosphate}} | {{#set: common name=phytolmonophosphate}} | ||
{{#set: produced by=RXN-7683}} | {{#set: produced by=RXN-7683}} | ||
Latest revision as of 14:29, 10 January 2019
Contents
Metabolite CPD-7025
- smiles:
- CC(CCCC(CCCC(C)CCCC(C)=CCOP([O-])(=O)[O-])C)C
- molecular weight:
- 374.499
- inchi key:
- InChIKey=YRXRHZOKDFCXIB-PYDDKJGSSA-L
- common name:
- phytyl monophosphate
- Synonym(s):
- phytolmonophosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(CCCC(CCCC(C)CCCC(C)=CCOP([O-])(=O)[O-])C)C" cannot be used as a page name in this wiki.
