Difference between revisions of "CPD-16817"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16817 CPD-16817] == * smiles: ** C2(C=CC1(=C(C(OS([O-])(=O)=O)=CN1)C=2)) * common name: **...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C2(C=CC1(=C(C(OS([O-])(=O)=O)=CN1)C=2)) | ** C2(C=CC1(=C(C(OS([O-])(=O)=O)=CN1)C=2)) | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 212.2 | ** 212.2 | ||
| + | * inchi key: | ||
| + | ** InChIKey=BXFFHSIDQOFMLE-UHFFFAOYSA-M | ||
| + | * common name: | ||
| + | ** indoxyl sulfate | ||
* Synonym(s): | * Synonym(s): | ||
** indol-3-yl sulfate | ** indol-3-yl sulfate | ||
| Line 17: | Line 17: | ||
* [[RXN-15587]] | * [[RXN-15587]] | ||
== External links == | == External links == | ||
| − | |||
| − | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=43355 43355] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=43355 43355] | ||
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=4453098 4453098] | ||
* HMDB : HMDB00682 | * HMDB : HMDB00682 | ||
| + | * GO-TERMS : (REFMET "Indoxyl sulfate" NIL midford 3701443689 NIL NIL) | ||
{{#set: smiles=C2(C=CC1(=C(C(OS([O-])(=O)=O)=CN1)C=2))}} | {{#set: smiles=C2(C=CC1(=C(C(OS([O-])(=O)=O)=CN1)C=2))}} | ||
| − | |||
| − | |||
{{#set: molecular weight=212.2 }} | {{#set: molecular weight=212.2 }} | ||
| + | {{#set: inchi key=InChIKey=BXFFHSIDQOFMLE-UHFFFAOYSA-M}} | ||
| + | {{#set: common name=indoxyl sulfate}} | ||
{{#set: common name=indol-3-yl sulfate}} | {{#set: common name=indol-3-yl sulfate}} | ||
{{#set: reversible reaction associated=RXN-15587}} | {{#set: reversible reaction associated=RXN-15587}} | ||
Latest revision as of 14:30, 10 January 2019
Contents
Metabolite CPD-16817
- smiles:
- C2(C=CC1(=C(C(OS([O-])(=O)=O)=CN1)C=2))
- molecular weight:
- 212.2
- inchi key:
- InChIKey=BXFFHSIDQOFMLE-UHFFFAOYSA-M
- common name:
- indoxyl sulfate
- Synonym(s):
- indol-3-yl sulfate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CHEBI:
- PUBCHEM:
- HMDB : HMDB00682
- GO-TERMS : (REFMET "Indoxyl sulfate" NIL midford 3701443689 NIL NIL)
"C2(C=CC1(=C(C(OS([O-])(=O)=O)=CN1)C=2))" cannot be used as a page name in this wiki.
