Difference between revisions of "CPD-16551"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16551 CPD-16551] == * smiles: ** C(OP([O-])(=O)[O-])C1(C(O)C(O)C(O)O1) * common name: ** &b...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C(OP([O-])(=O)[O-])C1(C(O)C(O)C(O)O1) | ** C(OP([O-])(=O)[O-])C1(C(O)C(O)C(O)O1) | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 228.095 | ** 228.095 | ||
| + | * inchi key: | ||
| + | ** InChIKey=KTVPXOYAKDPRHY-TXICZTDVSA-L | ||
| + | * common name: | ||
| + | ** β-D-ribose 5-phosphate | ||
* Synonym(s): | * Synonym(s): | ||
** β-D-ribofuranose 5-phosphate | ** β-D-ribofuranose 5-phosphate | ||
| Line 14: | Line 14: | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
* [[RXN-4313-CPD-4205/WATER//CPD-16551/CPD-4209.35.]] | * [[RXN-4313-CPD-4205/WATER//CPD-16551/CPD-4209.35.]] | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | |||
| − | |||
* CHEMSPIDER: | * CHEMSPIDER: | ||
** [http://www.chemspider.com/Chemical-Structure.394672.html 394672] | ** [http://www.chemspider.com/Chemical-Structure.394672.html 394672] | ||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=1235722 1235722] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=1235722 1235722] | ||
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=7140377 7140377] | ||
{{#set: smiles=C(OP([O-])(=O)[O-])C1(C(O)C(O)C(O)O1)}} | {{#set: smiles=C(OP([O-])(=O)[O-])C1(C(O)C(O)C(O)O1)}} | ||
| − | |||
| − | |||
{{#set: molecular weight=228.095 }} | {{#set: molecular weight=228.095 }} | ||
| + | {{#set: inchi key=InChIKey=KTVPXOYAKDPRHY-TXICZTDVSA-L}} | ||
| + | {{#set: common name=β-D-ribose 5-phosphate}} | ||
{{#set: common name=β-D-ribofuranose 5-phosphate|5-O-phosphono-β-D-ribofuranose}} | {{#set: common name=β-D-ribofuranose 5-phosphate|5-O-phosphono-β-D-ribofuranose}} | ||
| − | + | {{#set: produced by=RXN-4313-CPD-4205/WATER//CPD-16551/CPD-4209.35.}} | |
| − | {{#set: produced by=RXN-4313-CPD-4205/WATER//CPD-16551/CPD-4209.35. | + | |
Latest revision as of 14:31, 10 January 2019
Contents
Metabolite CPD-16551
- smiles:
- C(OP([O-])(=O)[O-])C1(C(O)C(O)C(O)O1)
- molecular weight:
- 228.095
- inchi key:
- InChIKey=KTVPXOYAKDPRHY-TXICZTDVSA-L
- common name:
- β-D-ribose 5-phosphate
- Synonym(s):
- β-D-ribofuranose 5-phosphate
- 5-O-phosphono-β-D-ribofuranose
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(OP([O-])(=O)[O-])C1(C(O)C(O)C(O)O1)" cannot be used as a page name in this wiki.
