Difference between revisions of "CPD-9897"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9897 CPD-9897] == * smiles: ** CC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CC...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** CC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(=C(C(OC)=CC(C([O-])=O)=C1)O))C)C)C)C)C)C)C)C)C)C | ** CC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(=C(C(OC)=CC(C([O-])=O)=C1)O))C)C)C)C)C)C)C)C)C)C | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 848.323 | ** 848.323 | ||
| + | * inchi key: | ||
| + | ** InChIKey=WCQCNOIKXGNDLX-RDSVHMIISA-M | ||
| + | * common name: | ||
| + | ** 3-methoxy-4-hydroxy-5-all-trans-decaprenylbenzoate | ||
* Synonym(s): | * Synonym(s): | ||
** 3-methoxy-4-hydroxy-5-decaprenylbenzoate | ** 3-methoxy-4-hydroxy-5-decaprenylbenzoate | ||
| Line 15: | Line 15: | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
* [[RXN-9282]] | * [[RXN-9282]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | |||
| − | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62796 62796] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62796 62796] | ||
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=54738023 54738023] | ||
{{#set: smiles=CC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(=C(C(OC)=CC(C([O-])=O)=C1)O))C)C)C)C)C)C)C)C)C)C}} | {{#set: smiles=CC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(=C(C(OC)=CC(C([O-])=O)=C1)O))C)C)C)C)C)C)C)C)C)C}} | ||
| − | |||
| − | |||
{{#set: molecular weight=848.323 }} | {{#set: molecular weight=848.323 }} | ||
| + | {{#set: inchi key=InChIKey=WCQCNOIKXGNDLX-RDSVHMIISA-M}} | ||
| + | {{#set: common name=3-methoxy-4-hydroxy-5-all-trans-decaprenylbenzoate}} | ||
{{#set: common name=3-methoxy-4-hydroxy-5-decaprenylbenzoate|3-(3,7,11,15,19,23-decamethyltetracosa-2,6,10,14,18,22-hexaenyl) -4-hydroxy-5-methoxy-benzoic acid|3-decaprenyl-4-hydroxy-5-methoxybenzoate}} | {{#set: common name=3-methoxy-4-hydroxy-5-decaprenylbenzoate|3-(3,7,11,15,19,23-decamethyltetracosa-2,6,10,14,18,22-hexaenyl) -4-hydroxy-5-methoxy-benzoic acid|3-decaprenyl-4-hydroxy-5-methoxybenzoate}} | ||
| − | |||
{{#set: produced by=RXN-9282}} | {{#set: produced by=RXN-9282}} | ||
Latest revision as of 14:32, 10 January 2019
Contents
Metabolite CPD-9897
- smiles:
- CC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(=C(C(OC)=CC(C([O-])=O)=C1)O))C)C)C)C)C)C)C)C)C)C
- molecular weight:
- 848.323
- inchi key:
- InChIKey=WCQCNOIKXGNDLX-RDSVHMIISA-M
- common name:
- 3-methoxy-4-hydroxy-5-all-trans-decaprenylbenzoate
- Synonym(s):
- 3-methoxy-4-hydroxy-5-decaprenylbenzoate
- 3-(3,7,11,15,19,23-decamethyltetracosa-2,6,10,14,18,22-hexaenyl) -4-hydroxy-5-methoxy-benzoic acid
- 3-decaprenyl-4-hydroxy-5-methoxybenzoate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCCC(=CCC1(=C(C(OC)=CC(C([O-])=O)=C1)O))C)C)C)C)C)C)C)C)C)C" cannot be used as a page name in this wiki.
