Difference between revisions of "MANNOSE-6P"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MANNOSE-6P MANNOSE-6P] == * smiles: ** C(OP(=O)([O-])[O-])C1(OC(O)C(O)C(O)C(O)1) * inchi key: *...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C(OP(=O)([O-])[O-])C1(OC(O)C(O)C(O)C(O)1) | ** C(OP(=O)([O-])[O-])C1(OC(O)C(O)C(O)C(O)1) | ||
| + | * molecular weight: | ||
| + | ** 258.121 | ||
* inchi key: | * inchi key: | ||
** InChIKey=NBSCHQHZLSJFNQ-PQMKYFCFSA-L | ** InChIKey=NBSCHQHZLSJFNQ-PQMKYFCFSA-L | ||
* common name: | * common name: | ||
** α-D-mannopyranose 6-phosphate | ** α-D-mannopyranose 6-phosphate | ||
| − | |||
| − | |||
* Synonym(s): | * Synonym(s): | ||
** α-D-mannose-6-P | ** α-D-mannose-6-P | ||
| Line 14: | Line 14: | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
* [[MANNKIN-RXN-CPD-12601/ATP//MANNOSE-6P/ADP/PROTON.37.]] | * [[MANNKIN-RXN-CPD-12601/ATP//MANNOSE-6P/ADP/PROTON.37.]] | ||
| + | * [[MANNKIN-RXN-D-mannopyranose/ATP//MANNOSE-6P/ADP/PROTON.43.]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
* [[PHOSMANMUT-RXN-MANNOSE-1P//MANNOSE-6P.23.]] | * [[PHOSMANMUT-RXN-MANNOSE-1P//MANNOSE-6P.23.]] | ||
* [[MANNPISOM-RXN-MANNOSE-6P//FRUCTOSE-6P.24.]] | * [[MANNPISOM-RXN-MANNOSE-6P//FRUCTOSE-6P.24.]] | ||
== External links == | == External links == | ||
| − | |||
* PUBCHEM: | * PUBCHEM: | ||
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244236 25244236] | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244236 25244236] | ||
| − | |||
| − | |||
| − | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=60332 60332] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=60332 60332] | ||
| + | * CAS : 3672-15-9 | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C00275 C00275] | ||
| + | * HMDB : HMDB01078 | ||
* BIGG : man6p | * BIGG : man6p | ||
{{#set: smiles=C(OP(=O)([O-])[O-])C1(OC(O)C(O)C(O)C(O)1)}} | {{#set: smiles=C(OP(=O)([O-])[O-])C1(OC(O)C(O)C(O)C(O)1)}} | ||
| + | {{#set: molecular weight=258.121 }} | ||
{{#set: inchi key=InChIKey=NBSCHQHZLSJFNQ-PQMKYFCFSA-L}} | {{#set: inchi key=InChIKey=NBSCHQHZLSJFNQ-PQMKYFCFSA-L}} | ||
{{#set: common name=α-D-mannopyranose 6-phosphate}} | {{#set: common name=α-D-mannopyranose 6-phosphate}} | ||
| − | |||
{{#set: common name=α-D-mannose-6-P}} | {{#set: common name=α-D-mannose-6-P}} | ||
| − | {{#set: produced by=MANNKIN-RXN- | + | {{#set: produced by=MANNKIN-RXN-CPD-12601/ATP//MANNOSE-6P/ADP/PROTON.37.|MANNKIN-RXN-D-mannopyranose/ATP//MANNOSE-6P/ADP/PROTON.43.}} |
{{#set: reversible reaction associated=PHOSMANMUT-RXN-MANNOSE-1P//MANNOSE-6P.23.|MANNPISOM-RXN-MANNOSE-6P//FRUCTOSE-6P.24.}} | {{#set: reversible reaction associated=PHOSMANMUT-RXN-MANNOSE-1P//MANNOSE-6P.23.|MANNPISOM-RXN-MANNOSE-6P//FRUCTOSE-6P.24.}} | ||
Latest revision as of 14:36, 10 January 2019
Contents
Metabolite MANNOSE-6P
- smiles:
- C(OP(=O)([O-])[O-])C1(OC(O)C(O)C(O)C(O)1)
- molecular weight:
- 258.121
- inchi key:
- InChIKey=NBSCHQHZLSJFNQ-PQMKYFCFSA-L
- common name:
- α-D-mannopyranose 6-phosphate
- Synonym(s):
- α-D-mannose-6-P
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
- MANNKIN-RXN-CPD-12601/ATP//MANNOSE-6P/ADP/PROTON.37.
- MANNKIN-RXN-D-mannopyranose/ATP//MANNOSE-6P/ADP/PROTON.43.
Reaction(s) of unknown directionality
External links
"C(OP(=O)([O-])[O-])C1(OC(O)C(O)C(O)C(O)1)" cannot be used as a page name in this wiki.
