Difference between revisions of "QUINATE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=QUINATE QUINATE] == * smiles: ** C([O-])(=O)C1(O)(CC(O)C(O)C(O)C1) * common name: ** L-quinate...") |
|||
| Line 2: | Line 2: | ||
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=QUINATE QUINATE] == | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=QUINATE QUINATE] == | ||
* smiles: | * smiles: | ||
| − | ** C([O-] | + | ** C(=O)([O-])C1(O)(CC(O)C(O)C(O)C1) |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* molecular weight: | * molecular weight: | ||
** 191.16 | ** 191.16 | ||
| + | * inchi key: | ||
| + | ** InChIKey=AAWZDTNXLSGCEK-WYWMIBKRSA-M | ||
| + | * common name: | ||
| + | ** L-quinate | ||
* Synonym(s): | * Synonym(s): | ||
** (-)-quinic acid | ** (-)-quinic acid | ||
| Line 15: | Line 15: | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
* [[RXN-7967]] | * [[RXN-7967]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | |||
| − | |||
| − | |||
* CHEMSPIDER: | * CHEMSPIDER: | ||
** [http://www.chemspider.com/Chemical-Structure.1272058.html 1272058] | ** [http://www.chemspider.com/Chemical-Structure.1272058.html 1272058] | ||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=29751 29751] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=29751 29751] | ||
| + | * CAS : 77-95-2 | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
** [http://www.genome.jp/dbget-bin/www_bget?C00296 C00296] | ** [http://www.genome.jp/dbget-bin/www_bget?C00296 C00296] | ||
| − | {{#set: smiles=C([O-] | + | * PUBCHEM: |
| − | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=1560034 1560034] | |
| − | + | {{#set: smiles=C(=O)([O-])C1(O)(CC(O)C(O)C(O)C1)}} | |
{{#set: molecular weight=191.16 }} | {{#set: molecular weight=191.16 }} | ||
| + | {{#set: inchi key=InChIKey=AAWZDTNXLSGCEK-WYWMIBKRSA-M}} | ||
| + | {{#set: common name=L-quinate}} | ||
{{#set: common name=(-)-quinic acid|(-)-quinate|(1S,3R,4S,5R)-1,3,4,5-tetrahydroxycyclohexanecarboxylate}} | {{#set: common name=(-)-quinic acid|(-)-quinate|(1S,3R,4S,5R)-1,3,4,5-tetrahydroxycyclohexanecarboxylate}} | ||
| − | {{#set: consumed by= | + | {{#set: consumed by=RXN-7967}} |
Latest revision as of 14:38, 10 January 2019
Contents
Metabolite QUINATE
- smiles:
- C(=O)([O-])C1(O)(CC(O)C(O)C(O)C1)
- molecular weight:
- 191.16
- inchi key:
- InChIKey=AAWZDTNXLSGCEK-WYWMIBKRSA-M
- common name:
- L-quinate
- Synonym(s):
- (-)-quinic acid
- (-)-quinate
- (1S,3R,4S,5R)-1,3,4,5-tetrahydroxycyclohexanecarboxylate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(=O)([O-])C1(O)(CC(O)C(O)C(O)C1)" cannot be used as a page name in this wiki.
