Difference between revisions of "CPD-7117"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7117 CPD-7117] == * smiles: ** C(O)C1(C(O)C(O)C(O)C(O1)OC3(C(C2(C=C(O)C(O)=C(O)C=2))=[O+]C4...") |
|||
Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C(O)C1(C(O)C(O)C(O)C(O1)OC3(C(C2(C=C(O)C(O)=C(O)C=2))=[O+]C4(C(C=3)=C([O-])C=C([O-])C=4))) | ** C(O)C1(C(O)C(O)C(O)C(O1)OC3(C(C2(C=C(O)C(O)=C(O)C=2))=[O+]C4(C(C=3)=C([O-])C=C([O-])C=4))) | ||
− | |||
− | |||
− | |||
− | |||
* molecular weight: | * molecular weight: | ||
** 463.374 | ** 463.374 | ||
+ | * inchi key: | ||
+ | ** InChIKey=XENHPQQLDPAYIJ-PEVLUNPASA-M | ||
+ | * common name: | ||
+ | ** delphinidin-3-O-β-D-glucoside | ||
* Synonym(s): | * Synonym(s): | ||
** delfinidin-3-O-glucoside | ** delfinidin-3-O-glucoside | ||
Line 17: | Line 17: | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | * | + | * CHEBI: |
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=31463 31463] | ||
* PUBCHEM: | * PUBCHEM: | ||
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=102515359 102515359] | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=102515359 102515359] | ||
* HMDB : HMDB37997 | * HMDB : HMDB37997 | ||
− | |||
− | |||
* LIGAND-CPD: | * LIGAND-CPD: | ||
** [http://www.genome.jp/dbget-bin/www_bget?C12138 C12138] | ** [http://www.genome.jp/dbget-bin/www_bget?C12138 C12138] | ||
+ | * LIPID_MAPS : LMPK12010278 | ||
{{#set: smiles=C(O)C1(C(O)C(O)C(O)C(O1)OC3(C(C2(C=C(O)C(O)=C(O)C=2))=[O+]C4(C(C=3)=C([O-])C=C([O-])C=4)))}} | {{#set: smiles=C(O)C1(C(O)C(O)C(O)C(O1)OC3(C(C2(C=C(O)C(O)=C(O)C=2))=[O+]C4(C(C=3)=C([O-])C=C([O-])C=4)))}} | ||
− | |||
− | |||
{{#set: molecular weight=463.374 }} | {{#set: molecular weight=463.374 }} | ||
+ | {{#set: inchi key=InChIKey=XENHPQQLDPAYIJ-PEVLUNPASA-M}} | ||
+ | {{#set: common name=delphinidin-3-O-β-D-glucoside}} | ||
{{#set: common name=delfinidin-3-O-glucoside}} | {{#set: common name=delfinidin-3-O-glucoside}} | ||
{{#set: consumed by=RXN-8228}} | {{#set: consumed by=RXN-8228}} |
Latest revision as of 14:40, 10 January 2019
Contents
Metabolite CPD-7117
- smiles:
- C(O)C1(C(O)C(O)C(O)C(O1)OC3(C(C2(C=C(O)C(O)=C(O)C=2))=[O+]C4(C(C=3)=C([O-])C=C([O-])C=4)))
- molecular weight:
- 463.374
- inchi key:
- InChIKey=XENHPQQLDPAYIJ-PEVLUNPASA-M
- common name:
- delphinidin-3-O-β-D-glucoside
- Synonym(s):
- delfinidin-3-O-glucoside
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(O)C1(C(O)C(O)C(O)C(O1)OC3(C(C2(C=C(O)C(O)=C(O)C=2))=[O+]C4(C(C=3)=C([O-])C=C([O-])C=4)))" cannot be used as a page name in this wiki.