Difference between revisions of "3Z-PHYCOERYTHROBILIN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3Z-PHYCOERYTHROBILIN 3Z-PHYCOERYTHROBILIN] == * smiles: ** CC=C1(C(C)C(NC1=CC4(=C(C)C(CCC([O-])...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** CC=C1(C(C)C(NC1=CC4(=C(C)C(CCC([O-])=O)=C(C=C2(C(CCC([O-])=O)=C(C)C(=N2)C[CH]3(C(C)=C(C=C)C(=O)N3)))N4))=O) | ** CC=C1(C(C)C(NC1=CC4(=C(C)C(CCC([O-])=O)=C(C=C2(C(CCC([O-])=O)=C(C)C(=N2)C[CH]3(C(C)=C(C=C)C(=O)N3)))N4))=O) | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 584.671 | ** 584.671 | ||
| + | * inchi key: | ||
| + | ** InChIKey=IGJXAXFFKKRFKU-ISRBKNAYSA-L | ||
| + | * common name: | ||
| + | ** (3Z)-phycoerythrobilin | ||
* Synonym(s): | * Synonym(s): | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
* [[1.3.7.3-RXN]] | * [[1.3.7.3-RXN]] | ||
| Line 18: | Line 17: | ||
* [[R05819]] | * [[R05819]] | ||
== External links == | == External links == | ||
| − | |||
| − | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57438 57438] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57438 57438] | ||
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91820182 91820182] | ||
{{#set: smiles=CC=C1(C(C)C(NC1=CC4(=C(C)C(CCC([O-])=O)=C(C=C2(C(CCC([O-])=O)=C(C)C(=N2)C[CH]3(C(C)=C(C=C)C(=O)N3)))N4))=O)}} | {{#set: smiles=CC=C1(C(C)C(NC1=CC4(=C(C)C(CCC([O-])=O)=C(C=C2(C(CCC([O-])=O)=C(C)C(=N2)C[CH]3(C(C)=C(C=C)C(=O)N3)))N4))=O)}} | ||
| − | |||
| − | |||
{{#set: molecular weight=584.671 }} | {{#set: molecular weight=584.671 }} | ||
| − | {{#set: | + | {{#set: inchi key=InChIKey=IGJXAXFFKKRFKU-ISRBKNAYSA-L}} |
| + | {{#set: common name=(3Z)-phycoerythrobilin}} | ||
{{#set: produced by=1.3.7.3-RXN}} | {{#set: produced by=1.3.7.3-RXN}} | ||
{{#set: reversible reaction associated=R05819}} | {{#set: reversible reaction associated=R05819}} | ||
Latest revision as of 14:47, 10 January 2019
Contents
Metabolite 3Z-PHYCOERYTHROBILIN
- smiles:
- CC=C1(C(C)C(NC1=CC4(=C(C)C(CCC([O-])=O)=C(C=C2(C(CCC([O-])=O)=C(C)C(=N2)C[CH]3(C(C)=C(C=C)C(=O)N3)))N4))=O)
- molecular weight:
- 584.671
- inchi key:
- InChIKey=IGJXAXFFKKRFKU-ISRBKNAYSA-L
- common name:
- (3Z)-phycoerythrobilin
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC=C1(C(C)C(NC1=CC4(=C(C)C(CCC([O-])=O)=C(C=C2(C(CCC([O-])=O)=C(C)C(=N2)C[CH]3(C(C)=C(C=C)C(=O)N3)))N4))=O)" cannot be used as a page name in this wiki.
