Difference between revisions of "CPD-17866"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17866 CPD-17866] == * smiles: ** C(SS([O-])=O)C(C(NCC([O-])=O)=O)NC(=O)CCC([N+])C([O-])=O *...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C(SS([O-])=O)C(C(NCC([O-])=O)=O)NC(=O)CCC([N+])C([O-])=O | ** C(SS([O-])=O)C(C(NCC([O-])=O)=O)NC(=O)CCC([N+])C([O-])=O | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 369.364 | ** 369.364 | ||
| + | * inchi key: | ||
| + | ** InChIKey=QUBUTNSZZFICHL-WDSKDSINSA-L | ||
| + | * common name: | ||
| + | ** S-sulfinatoglutathione | ||
* Synonym(s): | * Synonym(s): | ||
** GSSO2- | ** GSSO2- | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
* [[FESGSHTHIO-RXN]] | * [[FESGSHTHIO-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | |||
| − | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=85586 85586] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=85586 85586] | ||
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91819876 91819876] | ||
{{#set: smiles=C(SS([O-])=O)C(C(NCC([O-])=O)=O)NC(=O)CCC([N+])C([O-])=O}} | {{#set: smiles=C(SS([O-])=O)C(C(NCC([O-])=O)=O)NC(=O)CCC([N+])C([O-])=O}} | ||
| − | |||
| − | |||
{{#set: molecular weight=369.364 }} | {{#set: molecular weight=369.364 }} | ||
| + | {{#set: inchi key=InChIKey=QUBUTNSZZFICHL-WDSKDSINSA-L}} | ||
| + | {{#set: common name=S-sulfinatoglutathione}} | ||
{{#set: common name=GSSO2-}} | {{#set: common name=GSSO2-}} | ||
| − | |||
{{#set: produced by=FESGSHTHIO-RXN}} | {{#set: produced by=FESGSHTHIO-RXN}} | ||
Latest revision as of 14:49, 10 January 2019
Contents
Metabolite CPD-17866
- smiles:
- C(SS([O-])=O)C(C(NCC([O-])=O)=O)NC(=O)CCC([N+])C([O-])=O
- molecular weight:
- 369.364
- inchi key:
- InChIKey=QUBUTNSZZFICHL-WDSKDSINSA-L
- common name:
- S-sulfinatoglutathione
- Synonym(s):
- GSSO2-
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(SS([O-])=O)C(C(NCC([O-])=O)=O)NC(=O)CCC([N+])C([O-])=O" cannot be used as a page name in this wiki.
