Difference between revisions of "CPD-15924"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15924 CPD-15924] == * smiles: ** CCCCCCCCC=CCCCCCCCC(=O)OCC(COP([O-])([O-])=O)=O * common n...") |
|||
Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** CCCCCCCCC=CCCCCCCCC(=O)OCC(COP([O-])([O-])=O)=O | ** CCCCCCCCC=CCCCCCCCC(=O)OCC(COP([O-])([O-])=O)=O | ||
− | |||
− | |||
− | |||
− | |||
* molecular weight: | * molecular weight: | ||
** 432.493 | ** 432.493 | ||
+ | * inchi key: | ||
+ | ** InChIKey=YZKFNNQAEBNCEN-KTKRTIGZSA-L | ||
+ | * common name: | ||
+ | ** 1-oleoyl-2-lyso-glycerone phosphate | ||
* Synonym(s): | * Synonym(s): | ||
** 1-oleoyl-2-lyso-dihydroxyacetone phosphate | ** 1-oleoyl-2-lyso-dihydroxyacetone phosphate | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
* [[RXN-15044]] | * [[RXN-15044]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | |||
− | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=77492 77492] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=77492 77492] | ||
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=86289257 86289257] | ||
{{#set: smiles=CCCCCCCCC=CCCCCCCCC(=O)OCC(COP([O-])([O-])=O)=O}} | {{#set: smiles=CCCCCCCCC=CCCCCCCCC(=O)OCC(COP([O-])([O-])=O)=O}} | ||
− | |||
− | |||
{{#set: molecular weight=432.493 }} | {{#set: molecular weight=432.493 }} | ||
+ | {{#set: inchi key=InChIKey=YZKFNNQAEBNCEN-KTKRTIGZSA-L}} | ||
+ | {{#set: common name=1-oleoyl-2-lyso-glycerone phosphate}} | ||
{{#set: common name=1-oleoyl-2-lyso-dihydroxyacetone phosphate}} | {{#set: common name=1-oleoyl-2-lyso-dihydroxyacetone phosphate}} | ||
− | |||
{{#set: produced by=RXN-15044}} | {{#set: produced by=RXN-15044}} |
Latest revision as of 15:49, 10 January 2019
Contents
Metabolite CPD-15924
- smiles:
- CCCCCCCCC=CCCCCCCCC(=O)OCC(COP([O-])([O-])=O)=O
- molecular weight:
- 432.493
- inchi key:
- InChIKey=YZKFNNQAEBNCEN-KTKRTIGZSA-L
- common name:
- 1-oleoyl-2-lyso-glycerone phosphate
- Synonym(s):
- 1-oleoyl-2-lyso-dihydroxyacetone phosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCCCCCCCC=CCCCCCCCC(=O)OCC(COP([O-])([O-])=O)=O" cannot be used as a page name in this wiki.