Difference between revisions of "L-THREONINE-O-3-PHOSPHATE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-THREONINE-O-3-PHOSPHATE L-THREONINE-O-3-PHOSPHATE] == * smiles: ** CC(OP([O-])([O-])=O)C([N+]...") |
|||
Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** CC(OP([O-])([O-])=O)C([N+])C([O-])=O | ** CC(OP([O-])([O-])=O)C([N+])C([O-])=O | ||
− | |||
− | |||
− | |||
− | |||
* molecular weight: | * molecular weight: | ||
** 197.084 | ** 197.084 | ||
+ | * inchi key: | ||
+ | ** InChIKey=USRGIUJOYOXOQJ-GBXIJSLDSA-L | ||
+ | * common name: | ||
+ | ** L-threonine 3-O-phosphate | ||
* Synonym(s): | * Synonym(s): | ||
** O-phospho-L-threonine | ** O-phospho-L-threonine | ||
Line 18: | Line 18: | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | |||
* PUBCHEM: | * PUBCHEM: | ||
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=36688171 36688171] | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=36688171 36688171] | ||
− | |||
− | |||
− | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58675 58675] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58675 58675] | ||
+ | * CAS : 1114-81-4 | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C12147 C12147] | ||
+ | * HMDB : HMDB11185 | ||
* BIGG : thrp | * BIGG : thrp | ||
{{#set: smiles=CC(OP([O-])([O-])=O)C([N+])C([O-])=O}} | {{#set: smiles=CC(OP([O-])([O-])=O)C([N+])C([O-])=O}} | ||
− | |||
− | |||
{{#set: molecular weight=197.084 }} | {{#set: molecular weight=197.084 }} | ||
+ | {{#set: inchi key=InChIKey=USRGIUJOYOXOQJ-GBXIJSLDSA-L}} | ||
+ | {{#set: common name=L-threonine 3-O-phosphate}} | ||
{{#set: common name=O-phospho-L-threonine|phosphothreonine}} | {{#set: common name=O-phospho-L-threonine|phosphothreonine}} | ||
{{#set: consumed by=4.1.1.81-RXN}} | {{#set: consumed by=4.1.1.81-RXN}} |
Latest revision as of 14:50, 10 January 2019
Contents
Metabolite L-THREONINE-O-3-PHOSPHATE
- smiles:
- CC(OP([O-])([O-])=O)C([N+])C([O-])=O
- molecular weight:
- 197.084
- inchi key:
- InChIKey=USRGIUJOYOXOQJ-GBXIJSLDSA-L
- common name:
- L-threonine 3-O-phosphate
- Synonym(s):
- O-phospho-L-threonine
- phosphothreonine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(OP([O-])([O-])=O)C([N+])C([O-])=O" cannot be used as a page name in this wiki.