Difference between revisions of "CPD-12692"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12692 CPD-12692] == * smiles: ** C(S(=O)(=O)[O-])C(O)CO * common name: ** (2R)-3-sulfopropa...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C(S(=O)(=O)[O-])C(O)CO | ** C(S(=O)(=O)[O-])C(O)CO | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 155.145 | ** 155.145 | ||
| + | * inchi key: | ||
| + | ** InChIKey=YPFUJZAAZJXMIP-GSVOUGTGSA-M | ||
| + | * common name: | ||
| + | ** (2R)-3-sulfopropanediol | ||
* Synonym(s): | * Synonym(s): | ||
** (R)-2,3-dihydroxypropane 1-sulfonate | ** (R)-2,3-dihydroxypropane 1-sulfonate | ||
| Line 17: | Line 17: | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | |||
| − | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=60997 60997] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=60997 60997] | ||
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=49852442 49852442] | ||
{{#set: smiles=C(S(=O)(=O)[O-])C(O)CO}} | {{#set: smiles=C(S(=O)(=O)[O-])C(O)CO}} | ||
| − | |||
| − | |||
{{#set: molecular weight=155.145 }} | {{#set: molecular weight=155.145 }} | ||
| + | {{#set: inchi key=InChIKey=YPFUJZAAZJXMIP-GSVOUGTGSA-M}} | ||
| + | {{#set: common name=(2R)-3-sulfopropanediol}} | ||
{{#set: common name=(R)-2,3-dihydroxypropane 1-sulfonate}} | {{#set: common name=(R)-2,3-dihydroxypropane 1-sulfonate}} | ||
{{#set: consumed by=RXN-11727}} | {{#set: consumed by=RXN-11727}} | ||
Latest revision as of 14:52, 10 January 2019
Contents
Metabolite CPD-12692
- smiles:
- C(S(=O)(=O)[O-])C(O)CO
- molecular weight:
- 155.145
- inchi key:
- InChIKey=YPFUJZAAZJXMIP-GSVOUGTGSA-M
- common name:
- (2R)-3-sulfopropanediol
- Synonym(s):
- (R)-2,3-dihydroxypropane 1-sulfonate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(S(=O)(=O)[O-])C(O)CO" cannot be used as a page name in this wiki.
