Difference between revisions of "CPD-253"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-253 CPD-253] == * smiles: ** C(=O)C=C(CC([N+])C(=O)[O-])C=C(C([O-])=O)O * common name: ** 4...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C(=O)C=C(CC([N+])C(=O)[O-])C=C(C([O-])=O)O | ** C(=O)C=C(CC([N+])C(=O)[O-])C=C(C([O-])=O)O | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 228.181 | ** 228.181 | ||
| + | * inchi key: | ||
| + | ** InChIKey=FNEGJFDTWWXQES-QTWONPPNSA-M | ||
| + | * common name: | ||
| + | ** 4,5-seco-dopa | ||
* Synonym(s): | * Synonym(s): | ||
** 4-(L-alanin-3-yl)-2-hydroxy-cis,cis-muconate 6-semialdehyde | ** 4-(L-alanin-3-yl)-2-hydroxy-cis,cis-muconate 6-semialdehyde | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
* [[RXN-8460]] | * [[RXN-8460]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | |||
| − | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57639 57639] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57639 57639] | ||
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91820361 91820361] | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
** [http://www.genome.jp/dbget-bin/www_bget?C04796 C04796] | ** [http://www.genome.jp/dbget-bin/www_bget?C04796 C04796] | ||
{{#set: smiles=C(=O)C=C(CC([N+])C(=O)[O-])C=C(C([O-])=O)O}} | {{#set: smiles=C(=O)C=C(CC([N+])C(=O)[O-])C=C(C([O-])=O)O}} | ||
| − | |||
| − | |||
{{#set: molecular weight=228.181 }} | {{#set: molecular weight=228.181 }} | ||
| + | {{#set: inchi key=InChIKey=FNEGJFDTWWXQES-QTWONPPNSA-M}} | ||
| + | {{#set: common name=4,5-seco-dopa}} | ||
{{#set: common name=4-(L-alanin-3-yl)-2-hydroxy-cis,cis-muconate 6-semialdehyde}} | {{#set: common name=4-(L-alanin-3-yl)-2-hydroxy-cis,cis-muconate 6-semialdehyde}} | ||
| − | |||
{{#set: produced by=RXN-8460}} | {{#set: produced by=RXN-8460}} | ||
Latest revision as of 14:54, 10 January 2019
Contents
Metabolite CPD-253
- smiles:
- C(=O)C=C(CC([N+])C(=O)[O-])C=C(C([O-])=O)O
- molecular weight:
- 228.181
- inchi key:
- InChIKey=FNEGJFDTWWXQES-QTWONPPNSA-M
- common name:
- 4,5-seco-dopa
- Synonym(s):
- 4-(L-alanin-3-yl)-2-hydroxy-cis,cis-muconate 6-semialdehyde
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(=O)C=C(CC([N+])C(=O)[O-])C=C(C([O-])=O)O" cannot be used as a page name in this wiki.
