Difference between revisions of "CPD-15652"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15652 CPD-15652] == * smiles: ** CCCCCCC=CCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(O...") |
|||
Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** CCCCCCC=CCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] | ** CCCCCCC=CCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] | ||
− | |||
− | |||
− | |||
− | |||
* molecular weight: | * molecular weight: | ||
** 973.818 | ** 973.818 | ||
+ | * inchi key: | ||
+ | ** InChIKey=ADZJVTNIXNSNGU-OVQIFRBASA-J | ||
+ | * common name: | ||
+ | ** (3R)-hydroxy, 6-trans-tridecenoyl-CoA | ||
* Synonym(s): | * Synonym(s): | ||
** 3-hydroxy, 6E-tridecenoyl-CoA | ** 3-hydroxy, 6E-tridecenoyl-CoA | ||
Line 18: | Line 18: | ||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=122706233 122706233] |
{{#set: smiles=CCCCCCC=CCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} | {{#set: smiles=CCCCCCC=CCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} | ||
− | |||
− | |||
{{#set: molecular weight=973.818 }} | {{#set: molecular weight=973.818 }} | ||
+ | {{#set: inchi key=InChIKey=ADZJVTNIXNSNGU-OVQIFRBASA-J}} | ||
+ | {{#set: common name=(3R)-hydroxy, 6-trans-tridecenoyl-CoA}} | ||
{{#set: common name=3-hydroxy, 6E-tridecenoyl-CoA}} | {{#set: common name=3-hydroxy, 6E-tridecenoyl-CoA}} | ||
{{#set: produced by=RXN-14786}} | {{#set: produced by=RXN-14786}} |
Latest revision as of 14:56, 10 January 2019
Contents
Metabolite CPD-15652
- smiles:
- CCCCCCC=CCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- molecular weight:
- 973.818
- inchi key:
- InChIKey=ADZJVTNIXNSNGU-OVQIFRBASA-J
- common name:
- (3R)-hydroxy, 6-trans-tridecenoyl-CoA
- Synonym(s):
- 3-hydroxy, 6E-tridecenoyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"CCCCCCC=CCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.