Difference between revisions of "CPD-8563"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8563 CPD-8563] == * smiles: ** C(OP(=O)(O)O)C(C(=O)N[R])NC(=O)[R] * common name: ** myosin...") |
|||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8563 CPD-8563] == | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8563 CPD-8563] == | ||
| − | |||
| − | |||
* common name: | * common name: | ||
| − | ** myosin light-chain phosphate | + | ** a [myosin light-chain] L-serine phosphate phosphate |
* Synonym(s): | * Synonym(s): | ||
| Line 12: | Line 10: | ||
* [[2.7.11.18-RXN]] | * [[2.7.11.18-RXN]] | ||
== External links == | == External links == | ||
| − | + | {{#set: common name=a [myosin light-chain] L-serine phosphate phosphate}} | |
| − | + | ||
| − | + | ||
| − | {{#set: common name=myosin light-chain phosphate}} | + | |
{{#set: reversible reaction associated=2.7.11.18-RXN}} | {{#set: reversible reaction associated=2.7.11.18-RXN}} | ||
Latest revision as of 15:00, 10 January 2019
Contents
Metabolite CPD-8563
- common name:
- a [myosin light-chain] L-serine phosphate phosphate
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"a [myosin light-chain] L-serine phosphate phosphate" cannot be used as a page name in this wiki.
