Difference between revisions of "CPD-11855"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11855 CPD-11855] == * smiles: ** CC(O)(CC(C(=O)[O-])=O)C([O-])=O * common name: ** (R)-4-hy...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** CC(O)(CC(C(=O)[O-])=O)C([O-])=O | ** CC(O)(CC(C(=O)[O-])=O)C([O-])=O | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 174.11 | ** 174.11 | ||
| + | * inchi key: | ||
| + | ** InChIKey=YRWAMSXHYBBHFL-ZCFIWIBFSA-L | ||
| + | * common name: | ||
| + | ** (R)-4-hydroxy-4-methyl-2-oxoglutarate | ||
* Synonym(s): | * Synonym(s): | ||
** (D)-4-hydroxy-4-methyl-2-oxoglutarate | ** (D)-4-hydroxy-4-methyl-2-oxoglutarate | ||
| Line 18: | Line 18: | ||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45479581 45479581] |
{{#set: smiles=CC(O)(CC(C(=O)[O-])=O)C([O-])=O}} | {{#set: smiles=CC(O)(CC(C(=O)[O-])=O)C([O-])=O}} | ||
| − | |||
| − | |||
{{#set: molecular weight=174.11 }} | {{#set: molecular weight=174.11 }} | ||
| + | {{#set: inchi key=InChIKey=YRWAMSXHYBBHFL-ZCFIWIBFSA-L}} | ||
| + | {{#set: common name=(R)-4-hydroxy-4-methyl-2-oxoglutarate}} | ||
{{#set: common name=(D)-4-hydroxy-4-methyl-2-oxoglutarate}} | {{#set: common name=(D)-4-hydroxy-4-methyl-2-oxoglutarate}} | ||
{{#set: reversible reaction associated=RXN-12074}} | {{#set: reversible reaction associated=RXN-12074}} | ||
Latest revision as of 15:03, 10 January 2019
Contents
Metabolite CPD-11855
- smiles:
- CC(O)(CC(C(=O)[O-])=O)C([O-])=O
- molecular weight:
- 174.11
- inchi key:
- InChIKey=YRWAMSXHYBBHFL-ZCFIWIBFSA-L
- common name:
- (R)-4-hydroxy-4-methyl-2-oxoglutarate
- Synonym(s):
- (D)-4-hydroxy-4-methyl-2-oxoglutarate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"CC(O)(CC(C(=O)[O-])=O)C([O-])=O" cannot be used as a page name in this wiki.
