Difference between revisions of "DIHYDROPTERIN-CH2OH-PP"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIHYDROPTERIN-CH2OH-PP DIHYDROPTERIN-CH2OH-PP] == * smiles: ** C2(C(COP(=O)([O-])OP(=O)([O-])[O...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C2(C(COP(=O)([O-])OP(=O)([O-])[O-])=NC1(C(=O)NC(N)=NC=1N2)) | ** C2(C(COP(=O)([O-])OP(=O)([O-])[O-])=NC1(C(=O)NC(N)=NC=1N2)) | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 352.116 | ** 352.116 | ||
| + | * inchi key: | ||
| + | ** InChIKey=FCQGJGLSOWZZON-UHFFFAOYSA-K | ||
| + | * common name: | ||
| + | ** (7,8-dihydropterin-6-yl)methyl diphosphate | ||
* Synonym(s): | * Synonym(s): | ||
** 6-hydroxymethyl-dihydropterin pyrophosphate | ** 6-hydroxymethyl-dihydropterin pyrophosphate | ||
| Line 20: | Line 20: | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | |||
| − | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=73083 73083] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=73083 73083] | ||
| − | * | + | * PUBCHEM: |
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244074 25244074] | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
** [http://www.genome.jp/dbget-bin/www_bget?C04807 C04807] | ** [http://www.genome.jp/dbget-bin/www_bget?C04807 C04807] | ||
| + | * BIGG : 6hmhptpp | ||
{{#set: smiles=C2(C(COP(=O)([O-])OP(=O)([O-])[O-])=NC1(C(=O)NC(N)=NC=1N2))}} | {{#set: smiles=C2(C(COP(=O)([O-])OP(=O)([O-])[O-])=NC1(C(=O)NC(N)=NC=1N2))}} | ||
| − | |||
| − | |||
{{#set: molecular weight=352.116 }} | {{#set: molecular weight=352.116 }} | ||
| + | {{#set: inchi key=InChIKey=FCQGJGLSOWZZON-UHFFFAOYSA-K}} | ||
| + | {{#set: common name=(7,8-dihydropterin-6-yl)methyl diphosphate}} | ||
{{#set: common name=6-hydroxymethyl-dihydropterin pyrophosphate|6-hydroxymethyl-dihydropterin diphosphate|6-hydroxymethyl-7,8-dihydropterin diphosphate}} | {{#set: common name=6-hydroxymethyl-dihydropterin pyrophosphate|6-hydroxymethyl-dihydropterin diphosphate|6-hydroxymethyl-7,8-dihydropterin diphosphate}} | ||
{{#set: consumed by=H2PTEROATESYNTH-RXN}} | {{#set: consumed by=H2PTEROATESYNTH-RXN}} | ||
{{#set: produced by=H2PTERIDINEPYROPHOSPHOKIN-RXN}} | {{#set: produced by=H2PTERIDINEPYROPHOSPHOKIN-RXN}} | ||
Latest revision as of 15:04, 10 January 2019
Contents
Metabolite DIHYDROPTERIN-CH2OH-PP
- smiles:
- C2(C(COP(=O)([O-])OP(=O)([O-])[O-])=NC1(C(=O)NC(N)=NC=1N2))
- molecular weight:
- 352.116
- inchi key:
- InChIKey=FCQGJGLSOWZZON-UHFFFAOYSA-K
- common name:
- (7,8-dihydropterin-6-yl)methyl diphosphate
- Synonym(s):
- 6-hydroxymethyl-dihydropterin pyrophosphate
- 6-hydroxymethyl-dihydropterin diphosphate
- 6-hydroxymethyl-7,8-dihydropterin diphosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C2(C(COP(=O)([O-])OP(=O)([O-])[O-])=NC1(C(=O)NC(N)=NC=1N2))" cannot be used as a page name in this wiki.
