Difference between revisions of "CPD-13855"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13855 CPD-13855] == * smiles: ** C[N+]1(=CN(C2(N=C(N)NC(=O)C1=2))C3(OC(COP(=O)([O-])OP([O-]...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C[N+]1(=CN(C2(N=C(N)NC(=O)C1=2))C3(OC(COP(=O)([O-])OP([O-])([O-])=O)C(O)C(O)3)) | ** C[N+]1(=CN(C2(N=C(N)NC(=O)C1=2))C3(OC(COP(=O)([O-])OP([O-])([O-])=O)C(O)C(O)3)) | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 455.214 | ** 455.214 | ||
| + | * inchi key: | ||
| + | ** InChIKey=SBASPRRECYVBRF-KQYNXXCUSA-L | ||
| + | * common name: | ||
| + | ** N7-methylguanosine 5'-diphosphate | ||
* Synonym(s): | * Synonym(s): | ||
** 7-methylguanosine-5'-diphosphate | ** 7-methylguanosine-5'-diphosphate | ||
| Line 17: | Line 17: | ||
* [[RXN-12817]] | * [[RXN-12817]] | ||
== External links == | == External links == | ||
| − | |||
| − | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=63714 63714] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=63714 63714] | ||
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=56927952 56927952] | ||
{{#set: smiles=C[N+]1(=CN(C2(N=C(N)NC(=O)C1=2))C3(OC(COP(=O)([O-])OP([O-])([O-])=O)C(O)C(O)3))}} | {{#set: smiles=C[N+]1(=CN(C2(N=C(N)NC(=O)C1=2))C3(OC(COP(=O)([O-])OP([O-])([O-])=O)C(O)C(O)3))}} | ||
| − | |||
| − | |||
{{#set: molecular weight=455.214 }} | {{#set: molecular weight=455.214 }} | ||
| + | {{#set: inchi key=InChIKey=SBASPRRECYVBRF-KQYNXXCUSA-L}} | ||
| + | {{#set: common name=N7-methylguanosine 5'-diphosphate}} | ||
{{#set: common name=7-methylguanosine-5'-diphosphate}} | {{#set: common name=7-methylguanosine-5'-diphosphate}} | ||
{{#set: reversible reaction associated=RXN-12817}} | {{#set: reversible reaction associated=RXN-12817}} | ||
Latest revision as of 15:05, 10 January 2019
Contents
Metabolite CPD-13855
- smiles:
- C[N+]1(=CN(C2(N=C(N)NC(=O)C1=2))C3(OC(COP(=O)([O-])OP([O-])([O-])=O)C(O)C(O)3))
- molecular weight:
- 455.214
- inchi key:
- InChIKey=SBASPRRECYVBRF-KQYNXXCUSA-L
- common name:
- N7-methylguanosine 5'-diphosphate
- Synonym(s):
- 7-methylguanosine-5'-diphosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C[N+]1(=CN(C2(N=C(N)NC(=O)C1=2))C3(OC(COP(=O)([O-])OP([O-])([O-])=O)C(O)C(O)3))" cannot be used as a page name in this wiki.
